2',3-Dihydroxy-3'-methoxy-4,5-methylenedioxybibenzyl
Internal ID | 3199f869-42bf-47e7-ad25-9b0cc6bb5bb9 |
Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
IUPAC Name | 6-[2-(2-hydroxy-3-methoxyphenyl)ethyl]-1,3-benzodioxol-4-ol |
SMILES (Canonical) | COC1=CC=CC(=C1O)CCC2=CC(=C3C(=C2)OCO3)O |
SMILES (Isomeric) | COC1=CC=CC(=C1O)CCC2=CC(=C3C(=C2)OCO3)O |
InChI | InChI=1S/C16H16O5/c1-19-13-4-2-3-11(15(13)18)6-5-10-7-12(17)16-14(8-10)20-9-21-16/h2-4,7-8,17-18H,5-6,9H2,1H3 |
InChI Key | SHYDQWWTJFSDLA-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C16H16O5 |
Molecular Weight | 288.29 g/mol |
Exact Mass | 288.09977361 g/mol |
Topological Polar Surface Area (TPSA) | 68.20 Ų |
XlogP | 3.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.98% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.56% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.62% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 93.83% | 98.95% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 92.29% | 92.62% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.77% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.71% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.02% | 94.45% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 87.37% | 93.99% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.93% | 95.89% |
CHEMBL2535 | P11166 | Glucose transporter | 86.33% | 98.75% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 85.13% | 95.17% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.59% | 95.50% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.40% | 94.73% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 83.54% | 90.20% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 83.34% | 96.77% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.88% | 99.17% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 81.72% | 94.03% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.60% | 90.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.22% | 96.95% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.16% | 99.15% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.08% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Bulbophyllum andersonii |
PubChem | 14804127 |
LOTUS | LTS0072653 |
wikiData | Q105253342 |