2,3-Dihydropodocarpusflavone A
Internal ID | a76aa625-0fa7-437f-9e2b-5f000c2cf150 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Biflavonoids and polyflavonoids |
IUPAC Name | 8-[5-[(2S)-5,7-dihydroxy-4-oxo-2,3-dihydrochromen-2-yl]-2-hydroxyphenyl]-5,7-dihydroxy-2-(4-methoxyphenyl)chromen-4-one |
SMILES (Canonical) | COC1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C(=C(C=C3O)O)C4=C(C=CC(=C4)C5CC(=O)C6=C(C=C(C=C6O5)O)O)O |
SMILES (Isomeric) | COC1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C(=C(C=C3O)O)C4=C(C=CC(=C4)[C@@H]5CC(=O)C6=C(C=C(C=C6O5)O)O)O |
InChI | InChI=1S/C31H22O10/c1-39-17-5-2-14(3-6-17)25-13-24(38)30-22(36)11-21(35)28(31(30)41-25)18-8-15(4-7-19(18)33)26-12-23(37)29-20(34)9-16(32)10-27(29)40-26/h2-11,13,26,32-36H,12H2,1H3/t26-/m0/s1 |
InChI Key | LNCNPVIQJBSDBZ-SANMLTNESA-N |
Popularity | 0 references in papers |
Molecular Formula | C31H22O10 |
Molecular Weight | 554.50 g/mol |
Exact Mass | 554.12129689 g/mol |
Topological Polar Surface Area (TPSA) | 163.00 Ų |
XlogP | 5.10 |
852875-96-8 |
8-[5-[(2S)-5,7-dihydroxy-4-oxo-2,3-dihydrochromen-2-yl]-2-hydroxyphenyl]-5,7-dihydroxy-2-(4-methoxyphenyl)chromen-4-one |
AKOS032962666 |
![2D Structure of 2,3-Dihydropodocarpusflavone A 2D Structure of 2,3-Dihydropodocarpusflavone A](https://plantaedb.com/storage/docs/compounds/2023/11/23-dihydropodocarpusflavone-a.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.08% | 91.11% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 98.13% | 99.15% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.14% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 95.63% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.95% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.88% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.98% | 97.09% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 93.47% | 96.21% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.60% | 99.23% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 92.54% | 96.12% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 91.21% | 86.92% |
CHEMBL308 | P06493 | Cyclin-dependent kinase 1 | 90.30% | 91.73% |
CHEMBL3194 | P02766 | Transthyretin | 90.16% | 90.71% |
CHEMBL4208 | P20618 | Proteasome component C5 | 90.01% | 90.00% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 89.93% | 88.48% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 89.59% | 85.11% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.06% | 95.89% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.34% | 96.09% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 88.31% | 98.35% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.05% | 86.33% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.64% | 96.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.58% | 94.45% |
CHEMBL1907 | P15144 | Aminopeptidase N | 85.51% | 93.31% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 85.49% | 93.99% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.30% | 99.17% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 85.24% | 95.71% |
CHEMBL4630 | O14757 | Serine/threonine-protein kinase Chk1 | 84.52% | 97.03% |
CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 83.27% | 89.23% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 82.26% | 91.49% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 82.15% | 95.78% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 82.07% | 96.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.65% | 92.62% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.43% | 97.14% |
CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 81.06% | 95.53% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.55% | 91.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cycas beddomei |
PubChem | 12132892 |
LOTUS | LTS0083180 |
wikiData | Q105154263 |