2,3-Dihydrodarlingine
| Internal ID | 57c9db96-3915-4d5b-a863-d5608026060e |
| Taxonomy | Organoheterocyclic compounds > Pyrans > Pyranones and derivatives > Dihydropyranones |
| IUPAC Name | 4,5,12-trimethyl-6-oxa-12-azatricyclo[7.2.1.02,7]dodec-2(7)-en-3-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C13H19NO2/c1-7-8(2)16-11-6-9-4-5-10(14(9)3)12(11)13(7)15/h7-10H,4-6H2,1-3H3 |
| InChI Key | NFKOVCVVWNXFIF-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.141578849 g/mol |
| Topological Polar Surface Area (TPSA) | 29.50 Ų |
| XlogP | 1.40 |
| 2,3-Dihydrodarlingine |
| Cyclohepta(b)pyran-5,8-imin-4(5H)-one, 2,3,6,7,8,9-hexahydro-2,3,10-trimethyl- |
| DTXSID10993156 |
| 2,3,10-trimethyl-2,3,6,7,8,9-hexahydro-5,8-epiminocyclohepta[b]pyran-4(5H)-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 90.72% | 98.95% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 85.98% | 95.62% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.74% | 97.25% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.57% | 95.56% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.73% | 90.71% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 83.46% | 93.40% |
| CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 81.97% | 80.96% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.72% | 99.23% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.52% | 97.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.00% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Bellendena montana |
| PubChem | 156042 |
| LOTUS | LTS0078840 |
| wikiData | Q82983717 |