2,3-Dihydro-5-hydroxy-6,8,8-trimethyl-2-phenyl-4h-1-benzopyran-4,7(8h)-dione
Internal ID | 11d16101-033d-455d-8280-25abb576a4dc |
Taxonomy | Organoheterocyclic compounds > Benzopyrans |
IUPAC Name | 5-hydroxy-6,8,8-trimethyl-2-phenyl-2,3-dihydrochromene-4,7-dione |
SMILES (Canonical) | CC1=C(C2=C(C(C1=O)(C)C)OC(CC2=O)C3=CC=CC=C3)O |
SMILES (Isomeric) | CC1=C(C2=C(C(C1=O)(C)C)OC(CC2=O)C3=CC=CC=C3)O |
InChI | InChI=1S/C18H18O4/c1-10-15(20)14-12(19)9-13(11-7-5-4-6-8-11)22-17(14)18(2,3)16(10)21/h4-8,13,20H,9H2,1-3H3 |
InChI Key | CLTODYVARKMPCT-UHFFFAOYSA-N |
Popularity | 2 references in papers |
Molecular Formula | C18H18O4 |
Molecular Weight | 298.30 g/mol |
Exact Mass | 298.12050905 g/mol |
Topological Polar Surface Area (TPSA) | 63.60 Ų |
XlogP | 2.70 |
SCHEMBL13034006 |
CLTODYVARKMPCT-UHFFFAOYSA-N |
2,3-dihydro-5-hydroxy-6,8,8-trimethyl-2-phenyl-4h-1-benzopyran-4,7(8h)-dione |
![2D Structure of 2,3-Dihydro-5-hydroxy-6,8,8-trimethyl-2-phenyl-4h-1-benzopyran-4,7(8h)-dione 2D Structure of 2,3-Dihydro-5-hydroxy-6,8,8-trimethyl-2-phenyl-4h-1-benzopyran-4,7(8h)-dione](https://plantaedb.com/storage/docs/compounds/2023/11/23-dihydro-5-hydroxy-688-trimethyl-2-phenyl-4h-1-benzopyran-478h-dione.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.61% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.64% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.31% | 97.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.57% | 99.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.04% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.96% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 85.68% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.36% | 89.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.71% | 96.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.39% | 90.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.00% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Campomanesia lineatifolia |
PubChem | 44399548 |
LOTUS | LTS0218540 |
wikiData | Q104399001 |