2,3-Dihydro-2,3-dihydroxy-4-(4-methoxyphenyl)-1H-phenalen-1-one
| Internal ID | 7be0a510-97a3-4c77-9c88-3a4e90094ffd |
| Taxonomy | Benzenoids > Naphthalenes > Phenylnaphthalenes |
| IUPAC Name | 2,3-dihydroxy-4-(4-methoxyphenyl)-2,3-dihydrophenalen-1-one |
| SMILES (Canonical) | COC1=CC=C(C=C1)C2=C3C(C(C(=O)C4=CC=CC(=C43)C=C2)O)O |
| SMILES (Isomeric) | COC1=CC=C(C=C1)C2=C3C(C(C(=O)C4=CC=CC(=C43)C=C2)O)O |
| InChI | InChI=1S/C20H16O4/c1-24-13-8-5-11(6-9-13)14-10-7-12-3-2-4-15-16(12)17(14)19(22)20(23)18(15)21/h2-10,19-20,22-23H,1H3 |
| InChI Key | GMMBTTCHJJMJKQ-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C20H16O4 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.10485899 g/mol |
| Topological Polar Surface Area (TPSA) | 66.80 Ų |
| XlogP | 2.80 |
| 2,3-dihydroxy-4-(4-methoxyphenyl)-2,3-dihydrophenalen-1-one |
| 159853-37-9 |
| CHEBI:142247 |
| 2,3-dihydroxy-4-(4-methoxyphenyl)-2,3-dihydro-1H-phenalen-1-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1907 | P15144 | Aminopeptidase N | 97.32% | 93.31% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.34% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.45% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.22% | 94.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.60% | 96.09% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 90.86% | 91.49% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.46% | 86.33% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.67% | 91.11% |
| CHEMBL308 | P06493 | Cyclin-dependent kinase 1 | 85.42% | 91.73% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.16% | 99.23% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.67% | 98.75% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.55% | 86.92% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.25% | 99.17% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.81% | 97.09% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 81.54% | 96.67% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.29% | 99.15% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 80.90% | 96.09% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.63% | 82.69% |
| CHEMBL240 | Q12809 | HERG | 80.46% | 89.76% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Musa acuminata |
| PubChem | 10381323 |
| LOTUS | LTS0189471 |
| wikiData | Q105012016 |