2,3-Bis(4-acetyloxy-3-methoxyphenyl)propyl acetate
Internal ID | 09ab6c6d-1bc4-426a-9ba1-d19300a79c7d |
Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
IUPAC Name | 2,3-bis(4-acetyloxy-3-methoxyphenyl)propyl acetate |
SMILES (Canonical) | CC(=O)OCC(CC1=CC(=C(C=C1)OC(=O)C)OC)C2=CC(=C(C=C2)OC(=O)C)OC |
SMILES (Isomeric) | CC(=O)OCC(CC1=CC(=C(C=C1)OC(=O)C)OC)C2=CC(=C(C=C2)OC(=O)C)OC |
InChI | InChI=1S/C23H26O8/c1-14(24)29-13-19(18-7-9-21(31-16(3)26)23(12-18)28-5)10-17-6-8-20(30-15(2)25)22(11-17)27-4/h6-9,11-12,19H,10,13H2,1-5H3 |
InChI Key | LMPYFOIPMHSEQD-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H26O8 |
Molecular Weight | 430.40 g/mol |
Exact Mass | 430.16276778 g/mol |
Topological Polar Surface Area (TPSA) | 97.40 Ų |
XlogP | 3.30 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.89% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 95.79% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.48% | 94.45% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 93.07% | 90.20% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.84% | 99.17% |
CHEMBL2535 | P11166 | Glucose transporter | 91.71% | 98.75% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.14% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.48% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.16% | 96.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.08% | 95.50% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.81% | 90.00% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 80.66% | 89.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Pinus taeda |
PubChem | 101932963 |
LOTUS | LTS0136839 |
wikiData | Q105154110 |