(6S,8S,9S,10R,13R,14S,17R)-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-6-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one
Internal ID | ecae7db8-db41-415a-8a52-c58859c6f5a7 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Stigmastanes and derivatives |
IUPAC Name | (6S,8S,9S,10R,13R,14S,17R)-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-6-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
SMILES (Canonical) | CCC(C=CC(C)C1CCC2C1(CCC3C2CC(C4=CC(=O)CCC34C)O)C)C(C)C |
SMILES (Isomeric) | CC[C@H](/C=C/[C@@H](C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2C[C@@H](C4=CC(=O)CC[C@]34C)O)C)C(C)C |
InChI | InChI=1S/C29H46O2/c1-7-20(18(2)3)9-8-19(4)23-10-11-24-22-17-27(31)26-16-21(30)12-14-29(26,6)25(22)13-15-28(23,24)5/h8-9,16,18-20,22-25,27,31H,7,10-15,17H2,1-6H3/b9-8+/t19-,20-,22+,23-,24+,25+,27+,28-,29-/m1/s1 |
InChI Key | FFKIQLXJMQUBQZ-PCZQUQHRSA-N |
Popularity | 2 references in papers |
Molecular Formula | C29H46O2 |
Molecular Weight | 426.70 g/mol |
Exact Mass | 426.349780706 g/mol |
Topological Polar Surface Area (TPSA) | 37.30 Ų |
XlogP | 7.20 |
There are no found synonyms. |
![2D Structure of (6S,8S,9S,10R,13R,14S,17R)-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-6-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one 2D Structure of (6S,8S,9S,10R,13R,14S,17R)-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-6-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one](https://plantaedb.com/storage/docs/compounds/2023/07/22e-6alpha-hydroxystigmasta-422-diene-3-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.59% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.57% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.96% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.54% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 94.88% | 98.95% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 93.70% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.64% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.43% | 95.56% |
CHEMBL1871 | P10275 | Androgen Receptor | 91.20% | 96.43% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.48% | 95.89% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.66% | 90.17% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 87.96% | 82.69% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 87.75% | 96.77% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.16% | 85.14% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 84.72% | 95.93% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.92% | 90.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.61% | 86.33% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 80.57% | 85.30% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.44% | 96.95% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.29% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Alnus cordata |
Aloe deltoideodonta |
Bauhinia purpurea |
Crinum latifolium |
Hemionitis aschenborniana |
Leitneria floridana |
Oryza sativa |
Thermopsis mollis |
PubChem | 86333780 |
NPASS | NPC134737 |
LOTUS | LTS0180428 |
wikiData | Q104994509 |