(6,10-diacetyloxy-5-benzoyloxy-3-ethenyl-2,7,10a-trihydroxy-2,4b,8,8-tetramethyl-1-oxo-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-4-yl) benzoate
Internal ID | 183e7049-a44d-4e8b-ad76-639537705153 |
Taxonomy | Benzenoids > Phenanthrenes and derivatives > Hydrophenanthrenes |
IUPAC Name | (6,10-diacetyloxy-5-benzoyloxy-3-ethenyl-2,7,10a-trihydroxy-2,4b,8,8-tetramethyl-1-oxo-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-4-yl) benzoate |
SMILES (Canonical) | CC(=O)OC1CC2C(C(C(C(C2(C3C1(C(=O)C(C(C3OC(=O)C4=CC=CC=C4)C=C)(C)O)O)C)OC(=O)C5=CC=CC=C5)OC(=O)C)O)(C)C |
SMILES (Isomeric) | CC(=O)OC1CC2C(C(C(C(C2(C3C1(C(=O)C(C(C3OC(=O)C4=CC=CC=C4)C=C)(C)O)O)C)OC(=O)C5=CC=CC=C5)OC(=O)C)O)(C)C |
InChI | InChI=1S/C38H44O12/c1-8-24-27(49-32(42)22-15-11-9-12-16-22)29-36(6)25(19-26(47-20(2)39)38(29,46)34(44)37(24,7)45)35(4,5)30(41)28(48-21(3)40)31(36)50-33(43)23-17-13-10-14-18-23/h8-18,24-31,41,45-46H,1,19H2,2-7H3 |
InChI Key | PBUZGANPVDYQRM-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C38H44O12 |
Molecular Weight | 692.70 g/mol |
Exact Mass | 692.28327683 g/mol |
Topological Polar Surface Area (TPSA) | 183.00 Ų |
XlogP | 4.30 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.88% | 91.49% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.54% | 90.17% |
CHEMBL2581 | P07339 | Cathepsin D | 96.35% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.92% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.24% | 95.56% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 92.54% | 91.19% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.52% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.28% | 91.11% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 91.15% | 94.62% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.56% | 99.23% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 89.30% | 94.08% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.36% | 95.50% |
CHEMBL5028 | O14672 | ADAM10 | 85.87% | 97.50% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.66% | 85.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.55% | 89.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 83.05% | 82.69% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.99% | 91.07% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 82.01% | 83.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.92% | 97.14% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.84% | 93.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Orthosiphon aristatus |
Orthosiphon aristatus var. aristatus |
PubChem | 53247090 |
LOTUS | LTS0090997 |
wikiData | Q105205468 |