[(2R,3S,4S,5R,6S)-6-[[(1S,5S,6R,8R,10R,12S)-6-[2-(1-carbamimidoyl-2,5-dihydropyrrol-3-yl)ethylcarbamoyl]-12-hydroxy-7-[(2R)-2-[[(2S)-2-methoxy-3-sulfooxypropanoyl]amino]-4-methylpentanoyl]-3-oxo-2-oxa-4,7-diazatricyclo[6.3.1.01,5]dodecan-10-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl hexanoate
Internal ID | 8ced2d9f-f912-4aeb-aa5b-6d52f2079da8 |
Taxonomy | Lipids and lipid-like molecules > Saccharolipids |
IUPAC Name | [(2R,3S,4S,5R,6S)-6-[[(1S,5S,6R,8R,10R,12S)-6-[2-(1-carbamimidoyl-2,5-dihydropyrrol-3-yl)ethylcarbamoyl]-12-hydroxy-7-[(2R)-2-[[(2S)-2-methoxy-3-sulfooxypropanoyl]amino]-4-methylpentanoyl]-3-oxo-2-oxa-4,7-diazatricyclo[6.3.1.01,5]dodecan-10-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl hexanoate |
SMILES (Canonical) | CCCCCC(=O)OCC1C(C(C(C(O1)OC2CC3C(C4(C2)C(C(N3C(=O)C(CC(C)C)NC(=O)C(COS(=O)(=O)O)OC)C(=O)NCCC5=CCN(C5)C(=N)N)NC(=O)O4)O)O)O)O |
SMILES (Isomeric) | CCCCCC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O[C@@H]2C[C@@H]3[C@@H]([C@]4(C2)[C@H]([C@@H](N3C(=O)[C@@H](CC(C)C)NC(=O)[C@H](COS(=O)(=O)O)OC)C(=O)NCCC5=CCN(C5)C(=N)N)NC(=O)O4)O)O)O)O |
InChI | InChI=1S/C39H63N7O18S/c1-5-6-7-8-26(47)60-17-24-28(48)29(49)30(50)36(63-24)62-21-14-23-32(51)39(15-21)31(44-38(55)64-39)27(34(53)42-11-9-20-10-12-45(16-20)37(40)41)46(23)35(54)22(13-19(2)3)43-33(52)25(59-4)18-61-65(56,57)58/h10,19,21-25,27-32,36,48-51H,5-9,11-18H2,1-4H3,(H3,40,41)(H,42,53)(H,43,52)(H,44,55)(H,56,57,58)/t21-,22-,23-,24-,25+,27-,28-,29+,30-,31+,32+,36+,39+/m1/s1 |
InChI Key | KJFWBWHYMLHCPE-RNSLNDHDSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C39H63N7O18S |
Molecular Weight | 950.00 g/mol |
Exact Mass | 949.39502936 g/mol |
Topological Polar Surface Area (TPSA) | 377.00 Ų |
XlogP | -3.00 |
Atomic LogP (AlogP) | -3.11 |
H-Bond Acceptor | 18 |
H-Bond Donor | 10 |
Rotatable Bonds | 21 |
There are no found synonyms. |
![2D Structure of [(2R,3S,4S,5R,6S)-6-[[(1S,5S,6R,8R,10R,12S)-6-[2-(1-carbamimidoyl-2,5-dihydropyrrol-3-yl)ethylcarbamoyl]-12-hydroxy-7-[(2R)-2-[[(2S)-2-methoxy-3-sulfooxypropanoyl]amino]-4-methylpentanoyl]-3-oxo-2-oxa-4,7-diazatricyclo[6.3.1.01,5]dodecan-10-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl hexanoate 2D Structure of [(2R,3S,4S,5R,6S)-6-[[(1S,5S,6R,8R,10R,12S)-6-[2-(1-carbamimidoyl-2,5-dihydropyrrol-3-yl)ethylcarbamoyl]-12-hydroxy-7-[(2R)-2-[[(2S)-2-methoxy-3-sulfooxypropanoyl]amino]-4-methylpentanoyl]-3-oxo-2-oxa-4,7-diazatricyclo[6.3.1.01,5]dodecan-10-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl hexanoate](https://plantaedb.com/storage/docs/compounds/2023/07/22ab41a0-25a0-11ee-a7f9-45ace1d5f36f.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.8097 | 80.97% |
Caco-2 | - | 0.8638 | 86.38% |
Blood Brain Barrier | - | 0.8500 | 85.00% |
Human oral bioavailability | - | 0.7857 | 78.57% |
Subcellular localzation | Lysosomes | 0.4357 | 43.57% |
OATP2B1 inhibitior | - | 0.8630 | 86.30% |
OATP1B1 inhibitior | + | 0.8207 | 82.07% |
OATP1B3 inhibitior | + | 0.9256 | 92.56% |
MATE1 inhibitior | - | 0.8254 | 82.54% |
OCT2 inhibitior | - | 0.7750 | 77.50% |
BSEP inhibitior | + | 0.8021 | 80.21% |
P-glycoprotein inhibitior | + | 0.7455 | 74.55% |
P-glycoprotein substrate | + | 0.8617 | 86.17% |
CYP3A4 substrate | + | 0.7463 | 74.63% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8592 | 85.92% |
CYP3A4 inhibition | - | 0.8976 | 89.76% |
CYP2C9 inhibition | - | 0.7198 | 71.98% |
CYP2C19 inhibition | - | 0.6771 | 67.71% |
CYP2D6 inhibition | - | 0.8651 | 86.51% |
CYP1A2 inhibition | - | 0.6885 | 68.85% |
CYP2C8 inhibition | + | 0.7959 | 79.59% |
CYP inhibitory promiscuity | - | 0.9611 | 96.11% |
UGT catelyzed | - | 0.6000 | 60.00% |
Carcinogenicity (binary) | - | 0.6000 | 60.00% |
Carcinogenicity (trinary) | Non-required | 0.5211 | 52.11% |
Eye corrosion | - | 0.9756 | 97.56% |
Eye irritation | - | 0.9029 | 90.29% |
Skin irritation | - | 0.7510 | 75.10% |
Skin corrosion | - | 0.9074 | 90.74% |
Ames mutagenesis | - | 0.6054 | 60.54% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.5283 | 52.83% |
Micronuclear | + | 0.8000 | 80.00% |
Hepatotoxicity | - | 0.5052 | 50.52% |
skin sensitisation | - | 0.8202 | 82.02% |
Respiratory toxicity | + | 0.7667 | 76.67% |
Reproductive toxicity | + | 0.9111 | 91.11% |
Mitochondrial toxicity | + | 0.6125 | 61.25% |
Nephrotoxicity | - | 0.8054 | 80.54% |
Acute Oral Toxicity (c) | III | 0.5720 | 57.20% |
Estrogen receptor binding | + | 0.8472 | 84.72% |
Androgen receptor binding | + | 0.7238 | 72.38% |
Thyroid receptor binding | + | 0.5585 | 55.85% |
Glucocorticoid receptor binding | + | 0.6940 | 69.40% |
Aromatase binding | + | 0.6617 | 66.17% |
PPAR gamma | + | 0.7809 | 78.09% |
Honey bee toxicity | - | 0.6518 | 65.18% |
Biodegradation | - | 0.7750 | 77.50% |
Crustacea aquatic toxicity | + | 0.6200 | 62.00% |
Fish aquatic toxicity | + | 0.9508 | 95.08% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.69% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 99.65% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.94% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.78% | 94.45% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 98.58% | 89.63% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 98.10% | 97.09% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 97.96% | 95.71% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 97.43% | 91.81% |
CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 97.32% | 94.66% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.23% | 97.25% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 97.12% | 90.17% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 96.98% | 100.00% |
CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 96.87% | 90.24% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 96.80% | 93.56% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 96.18% | 92.86% |
CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 95.09% | 92.29% |
CHEMBL299 | P17252 | Protein kinase C alpha | 93.79% | 98.03% |
CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 93.68% | 96.28% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 93.50% | 96.47% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 93.46% | 98.59% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 92.61% | 96.90% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 92.60% | 90.71% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 92.42% | 96.21% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 92.31% | 97.79% |
CHEMBL5028 | O14672 | ADAM10 | 92.24% | 97.50% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 92.17% | 98.05% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.02% | 96.00% |
CHEMBL1801 | P00747 | Plasminogen | 91.91% | 92.44% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 91.91% | 97.14% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 91.64% | 97.21% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 91.47% | 92.50% |
CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 91.23% | 95.00% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 91.03% | 94.00% |
CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 90.79% | 96.25% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.56% | 99.23% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 89.94% | 94.33% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 89.71% | 100.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.54% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.06% | 95.56% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 88.07% | 98.33% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 87.47% | 95.17% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 87.19% | 100.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.90% | 91.19% |
CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 86.66% | 96.31% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.60% | 89.00% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 86.23% | 95.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.16% | 95.89% |
CHEMBL5646 | Q6L5J4 | FML2_HUMAN | 86.13% | 100.00% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 85.00% | 95.83% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 84.89% | 89.62% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 84.66% | 90.08% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 84.14% | 91.03% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 83.82% | 96.38% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 83.02% | 97.29% |
CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 82.40% | 97.50% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 82.25% | 92.08% |
CHEMBL3776 | Q14790 | Caspase-8 | 82.21% | 97.06% |
CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 82.02% | 83.10% |
CHEMBL2850 | P49840 | Glycogen synthase kinase-3 alpha | 81.85% | 88.84% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.37% | 85.14% |
CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 80.62% | 97.64% |
CHEMBL1871 | P10275 | Androgen Receptor | 80.60% | 96.43% |
CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 80.50% | 92.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Neurolaena lobata |
PubChem | 102411752 |
NPASS | NPC189454 |
LOTUS | LTS0152318 |
wikiData | Q105141828 |