methyl (10R,28R,29R)-10,28-diethyl-2-oxa-6,14,24,37-tetrazaundecacyclo[26.9.2.110,14.01,30.03,20.05,18.07,17.022,30.024,29.031,36.017,40]tetraconta-3,5(18),7,11,19,31,33,35-octaene-38-carboxylate
Internal ID | 5c91b93f-790a-4ced-9a45-7b3cf763149a |
Taxonomy | Alkaloids and derivatives > Aspidospermatan-type alkaloids |
IUPAC Name | methyl (10R,28R,29R)-10,28-diethyl-2-oxa-6,14,24,37-tetrazaundecacyclo[26.9.2.110,14.01,30.03,20.05,18.07,17.022,30.024,29.031,36.017,40]tetraconta-3,5(18),7,11,19,31,33,35-octaene-38-carboxylate |
SMILES (Canonical) | CCC12CCCN3C1C45C(C3)CC6=CC7=C(C=C6OC4(C(C2)C(=O)OC)NC8=CC=CC=C58)NC9=CCC1(C=CCN2C1C97CC2)CC |
SMILES (Isomeric) | CC[C@]12CCCN3[C@H]1C45C(C3)CC6=CC7=C(C=C6OC4(C(C2)C(=O)OC)NC8=CC=CC=C58)NC9=CC[C@@]1(C=CCN2C1C97CC2)CC |
InChI | InChI=1S/C41H48N4O3/c1-4-37-13-8-17-44-19-16-39(35(37)44)28-21-25-20-26-24-45-18-9-14-38(5-2)23-29(34(46)47-3)41(48-32(25)22-31(28)42-33(39)12-15-37)40(26,36(38)45)27-10-6-7-11-30(27)43-41/h6-8,10-13,21-22,26,29,35-36,42-43H,4-5,9,14-20,23-24H2,1-3H3/t26?,29?,35?,36-,37+,38-,39?,40?,41?/m1/s1 |
InChI Key | ULEIPIBNAUMOML-WWEBMVIBSA-N |
Popularity | 0 references in papers |
Molecular Formula | C41H48N4O3 |
Molecular Weight | 644.80 g/mol |
Exact Mass | 644.37264141 g/mol |
Topological Polar Surface Area (TPSA) | 66.10 Ų |
XlogP | 6.90 |
There are no found synonyms. |
![2D Structure of methyl (10R,28R,29R)-10,28-diethyl-2-oxa-6,14,24,37-tetrazaundecacyclo[26.9.2.110,14.01,30.03,20.05,18.07,17.022,30.024,29.031,36.017,40]tetraconta-3,5(18),7,11,19,31,33,35-octaene-38-carboxylate 2D Structure of methyl (10R,28R,29R)-10,28-diethyl-2-oxa-6,14,24,37-tetrazaundecacyclo[26.9.2.110,14.01,30.03,20.05,18.07,17.022,30.024,29.031,36.017,40]tetraconta-3,5(18),7,11,19,31,33,35-octaene-38-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/228b35d0-824d-11ee-9e4d-151b85e85126.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 98.67% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.64% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.57% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.16% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.75% | 86.33% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 92.39% | 96.61% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.61% | 95.56% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 90.19% | 82.69% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 89.41% | 95.83% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 89.01% | 93.03% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.79% | 94.45% |
CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 88.36% | 90.95% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 87.19% | 89.63% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.29% | 90.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.25% | 99.23% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.11% | 97.14% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.04% | 92.62% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.50% | 97.09% |
CHEMBL5028 | O14672 | ADAM10 | 83.90% | 97.50% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 83.24% | 97.28% |
CHEMBL236 | P41143 | Delta opioid receptor | 81.30% | 99.35% |
CHEMBL2535 | P11166 | Glucose transporter | 81.09% | 98.75% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 80.80% | 91.79% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.46% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Melodinus fusiformis |
PubChem | 102469734 |
LOTUS | LTS0204844 |
wikiData | Q105275064 |