2,2,7-Trimethylbenzo[g]chromene-5,10-dione
| Internal ID | fa432998-9525-4beb-9f2a-3b2f31ea2c3a |
| Taxonomy | Organoheterocyclic compounds > Naphthopyrans > Naphthopyranones |
| IUPAC Name | 2,2,7-trimethylbenzo[g]chromene-5,10-dione |
| SMILES (Canonical) | CC1=CC2=C(C=C1)C(=O)C3=C(C2=O)C=CC(O3)(C)C |
| SMILES (Isomeric) | CC1=CC2=C(C=C1)C(=O)C3=C(C2=O)C=CC(O3)(C)C |
| InChI | InChI=1S/C16H14O3/c1-9-4-5-10-12(8-9)13(17)11-6-7-16(2,3)19-15(11)14(10)18/h4-8H,1-3H3 |
| InChI Key | LDMGJEWOYSYKGP-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.094294304 g/mol |
| Topological Polar Surface Area (TPSA) | 43.40 Ų |
| XlogP | 3.00 |
| There are no found synonyms. |
![2D Structure of 2,2,7-Trimethylbenzo[g]chromene-5,10-dione](https://plantaedb.com/storage/docs/compounds/2023/11/227-trimethylbenzogchromene-510-dione.jpg "2D Structure of 2,2,7-Trimethylbenzo[g]chromene-5,10-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2039 | P27338 | Monoamine oxidase B | 98.56% | 92.51% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 96.38% | 91.49% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.77% | 95.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 90.85% | 94.73% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.67% | 98.95% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 87.76% | 93.18% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.55% | 89.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.99% | 91.11% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 86.24% | 93.31% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.29% | 90.71% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 84.08% | 96.67% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.55% | 86.33% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 82.42% | 96.38% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.92% | 100.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.00% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Microglossa pyrrhopappa |
| PubChem | 163069933 |
| LOTUS | LTS0164699 |
| wikiData | Q105178574 |