4-(3-Hydroxy-3-methylpent-4-enyl)-3a,5,7b-trimethyl-1,1a,2,3,4,6,7,7a-octahydrocyclopropa[a]naphthalen-5-ol
| Internal ID | ceb9c504-53a5-4eba-8e33-50be1f2140e1 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | 4-(3-hydroxy-3-methylpent-4-enyl)-3a,5,7b-trimethyl-1,1a,2,3,4,6,7,7a-octahydrocyclopropa[a]naphthalen-5-ol |
| SMILES (Canonical) | CC12CCC3CC3(C1CCC(C2CCC(C)(C=C)O)(C)O)C |
| SMILES (Isomeric) | CC12CCC3CC3(C1CCC(C2CCC(C)(C=C)O)(C)O)C |
| InChI | InChI=1S/C20H34O2/c1-6-17(2,21)10-8-16-18(3)11-7-14-13-19(14,4)15(18)9-12-20(16,5)22/h6,14-16,21-22H,1,7-13H2,2-5H3 |
| InChI Key | BRAYABJZDYAJCB-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.50 g/mol |
| Exact Mass | 306.255880323 g/mol |
| Topological Polar Surface Area (TPSA) | 40.50 Ų |
| XlogP | 4.40 |
| There are no found synonyms. |
![2D Structure of 4-(3-Hydroxy-3-methylpent-4-enyl)-3a,5,7b-trimethyl-1,1a,2,3,4,6,7,7a-octahydrocyclopropa[a]naphthalen-5-ol](https://plantaedb.com/storage/docs/compounds/2023/11/226daf20-85ee-11ee-8e69-7d72daddfc7b.jpg "2D Structure of 4-(3-Hydroxy-3-methylpent-4-enyl)-3a,5,7b-trimethyl-1,1a,2,3,4,6,7,7a-octahydrocyclopropa[a]naphthalen-5-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.69% | 97.25% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 92.29% | 97.64% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.85% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.36% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.42% | 97.09% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 90.37% | 90.93% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 89.23% | 94.75% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 88.24% | 95.92% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.33% | 100.00% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 84.32% | 92.98% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 84.04% | 97.79% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.45% | 95.89% |
| CHEMBL1871 | P10275 | Androgen Receptor | 81.38% | 96.43% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.22% | 92.94% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 81.19% | 89.05% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 80.21% | 95.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Pseudognaphalium schraderi |
| Pseudognaphalium viscosum |
| PubChem | 162892681 |
| LOTUS | LTS0097594 |
| wikiData | Q104944691 |