2-[4-[3,4-Dihydroxy-6-methyl-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxyphenyl]-7-hydroxy-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxychromen-4-one
| Internal ID | 903837ec-cb92-4243-86c6-9e72397db54e |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides |
| IUPAC Name | 2-[4-[3,4-dihydroxy-6-methyl-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxyphenyl]-7-hydroxy-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxychromen-4-one |
| SMILES (Canonical) | CC1C(C(C(C(O1)OC2=CC(=CC3=C2C(=O)C=C(O3)C4=CC=C(C=C4)OC5C(C(C(C(O5)C)OC6C(C(C(C(O6)CO)O)O)O)O)O)O)O)O)O |
| SMILES (Isomeric) | CC1C(C(C(C(O1)OC2=CC(=CC3=C2C(=O)C=C(O3)C4=CC=C(C=C4)OC5C(C(C(C(O5)C)OC6C(C(C(C(O6)CO)O)O)O)O)O)O)O)O)O |
| InChI | InChI=1S/C33H40O18/c1-11-22(37)24(39)27(42)32(45-11)49-19-8-14(35)7-18-21(19)16(36)9-17(48-18)13-3-5-15(6-4-13)47-31-29(44)26(41)30(12(2)46-31)51-33-28(43)25(40)23(38)20(10-34)50-33/h3-9,11-12,20,22-35,37-44H,10H2,1-2H3 |
| InChI Key | JMLXPKIHYARJSZ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C33H40O18 |
| Molecular Weight | 724.70 g/mol |
| Exact Mass | 724.22146442 g/mol |
| Topological Polar Surface Area (TPSA) | 284.00 Ų |
| XlogP | -2.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.18% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.21% | 94.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.90% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.65% | 98.95% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 96.12% | 83.57% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.97% | 86.33% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 92.98% | 86.92% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 91.96% | 91.49% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.66% | 94.73% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 89.53% | 95.78% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.22% | 99.17% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 88.86% | 96.21% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 88.78% | 97.36% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.25% | 95.56% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.44% | 99.15% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.85% | 97.09% |
| CHEMBL3194 | P02766 | Transthyretin | 85.59% | 90.71% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.94% | 95.89% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.80% | 90.71% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.62% | 95.89% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.50% | 90.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.14% | 96.09% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 80.70% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Asplenium normale |
| PubChem | 163021365 |
| LOTUS | LTS0083388 |
| wikiData | Q105131522 |