2,2',5,5'-Tetrahydroxy-3-methoxybibenzyl
Internal ID | b3be87bb-5126-4e44-9da4-29aedfa7d26b |
Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
IUPAC Name | 2-[2-(2,5-dihydroxyphenyl)ethyl]-6-methoxybenzene-1,4-diol |
SMILES (Canonical) | COC1=CC(=CC(=C1O)CCC2=C(C=CC(=C2)O)O)O |
SMILES (Isomeric) | COC1=CC(=CC(=C1O)CCC2=C(C=CC(=C2)O)O)O |
InChI | InChI=1S/C15H16O5/c1-20-14-8-12(17)7-10(15(14)19)3-2-9-6-11(16)4-5-13(9)18/h4-8,16-19H,2-3H2,1H3 |
InChI Key | FGNBOMRJUMMFTI-UHFFFAOYSA-N |
Popularity | 3 references in papers |
Molecular Formula | C15H16O5 |
Molecular Weight | 276.28 g/mol |
Exact Mass | 276.09977361 g/mol |
Topological Polar Surface Area (TPSA) | 90.20 Ų |
XlogP | 2.70 |
There are no found synonyms. |
![2D Structure of 2,2',5,5'-Tetrahydroxy-3-methoxybibenzyl 2D Structure of 2,2',5,5'-Tetrahydroxy-3-methoxybibenzyl](https://plantaedb.com/storage/docs/compounds/2023/11/2255-tetrahydroxy-3-methoxybibenzyl.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.83% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.20% | 96.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.97% | 99.15% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.69% | 86.33% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 91.40% | 89.62% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.12% | 99.17% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 88.77% | 90.20% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.66% | 90.00% |
CHEMBL3194 | P02766 | Transthyretin | 88.60% | 90.71% |
CHEMBL2581 | P07339 | Cathepsin D | 88.32% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.91% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.68% | 95.56% |
CHEMBL2535 | P11166 | Glucose transporter | 82.57% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dioscorea bulbifera |
PubChem | 129834560 |
LOTUS | LTS0167544 |
wikiData | Q104994973 |