(1S,4S,6S,9S,10R,12R,13S,17R,18S)-6-[(2R,4S,5R,6R)-4-methoxy-5-[(2S,4S,5R,6R)-4-methoxy-5-[(2S,4R,5R,6R)-4-methoxy-5-[(2S,4R,5R,6R)-4-methoxy-6-methyl-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-6-methyloxan-2-yl]oxy-6-methyloxan-2-yl]oxy-6-methyloxan-2-yl]oxy-9,13,18-trimethyl-19,20-dioxapentacyclo[10.7.1.01,10.04,9.013,17]icosan-14-one
| Internal ID | 42bff03b-b5c1-4c1f-a773-f5f838980a60 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
| IUPAC Name | (1S,4S,6S,9S,10R,12R,13S,17R,18S)-6-[(2R,4S,5R,6R)-4-methoxy-5-[(2S,4S,5R,6R)-4-methoxy-5-[(2S,4R,5R,6R)-4-methoxy-5-[(2S,4R,5R,6R)-4-methoxy-6-methyl-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-6-methyloxan-2-yl]oxy-6-methyloxan-2-yl]oxy-6-methyloxan-2-yl]oxy-9,13,18-trimethyl-19,20-dioxapentacyclo[10.7.1.01,10.04,9.013,17]icosan-14-one |
| SMILES (Canonical) | CC1C2CCC(=O)C2(C3CC4C5(CCC(CC5CCC4(O1)O3)OC6CC(C(C(O6)C)OC7CC(C(C(O7)C)OC8CC(C(C(O8)C)OC9CC(C(C(O9)C)OC1C(C(C(C(O1)CO)O)O)O)OC)OC)OC)OC)C)C |
| SMILES (Isomeric) | C[C@H]1[C@@H]2CCC(=O)[C@@]2([C@H]3C[C@@H]4[C@]5(CC[C@@H](C[C@@H]5CC[C@]4(O1)O3)O[C@H]6C[C@@H]([C@@H]([C@H](O6)C)O[C@H]7C[C@@H]([C@@H]([C@H](O7)C)O[C@H]8C[C@H]([C@@H]([C@H](O8)C)O[C@H]9C[C@H]([C@@H]([C@H](O9)C)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)OC)OC)OC)OC)C)C |
| InChI | InChI=1S/C55H90O21/c1-25-32-12-13-39(57)54(32,7)40-23-38-53(6)16-15-31(18-30(53)14-17-55(38,75-25)76-40)69-41-19-33(61-8)48(26(2)65-41)71-42-20-34(62-9)49(27(3)66-42)72-43-21-35(63-10)50(28(4)67-43)73-44-22-36(64-11)51(29(5)68-44)74-52-47(60)46(59)45(58)37(24-56)70-52/h25-38,40-52,56,58-60H,12-24H2,1-11H3/t25-,26+,27+,28+,29+,30-,31-,32-,33-,34-,35+,36+,37+,38+,40+,41-,42-,43-,44-,45+,46-,47+,48+,49+,50+,51+,52-,53-,54+,55-/m0/s1 |
| InChI Key | QGABNUDFDSOBRD-PHSWJIFNSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C55H90O21 |
| Molecular Weight | 1087.30 g/mol |
| Exact Mass | 1086.59745988 g/mol |
| Topological Polar Surface Area (TPSA) | 246.00 Ų |
| XlogP | 2.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.15% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.07% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.11% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.87% | 97.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.82% | 100.00% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 90.83% | 95.93% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 89.71% | 96.21% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 89.61% | 94.75% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.77% | 97.25% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.71% | 92.94% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.31% | 94.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.51% | 92.62% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.90% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 85.46% | 98.95% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.45% | 92.50% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.19% | 99.23% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 83.68% | 97.33% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.74% | 95.89% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.64% | 95.89% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.36% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.08% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Asclepias tuberosa |
| PubChem | 162848996 |
| LOTUS | LTS0131725 |
| wikiData | Q105219874 |