2,2,4,8-Tetramethyltricyclo[5.3.1.04,11]undecan-11-ol
| Internal ID | f46b2e52-a43e-45fe-bb55-8309ef129754 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | 2,2,4,8-tetramethyltricyclo[5.3.1.04,11]undecan-11-ol |
| SMILES (Canonical) | CC1CCC2C(CC3(C2(C1CC3)O)C)(C)C |
| SMILES (Isomeric) | CC1CCC2C(CC3(C2(C1CC3)O)C)(C)C |
| InChI | InChI=1S/C15H26O/c1-10-5-6-12-13(2,3)9-14(4)8-7-11(10)15(12,14)16/h10-12,16H,5-9H2,1-4H3 |
| InChI Key | ZCRYDCBITZERMT-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.198365449 g/mol |
| Topological Polar Surface Area (TPSA) | 20.20 Ų |
| XlogP | 3.90 |
| CHEMBL1966097 |
| NSC-688234 |
| NCI60_031832 |
![2D Structure of 2,2,4,8-Tetramethyltricyclo[5.3.1.04,11]undecan-11-ol](https://plantaedb.com/storage/docs/compounds/2023/11/2248-tetramethyltricyclo5310411undecan-11-ol.jpg "2D Structure of 2,2,4,8-Tetramethyltricyclo[5.3.1.04,11]undecan-11-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.22% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.07% | 96.09% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 87.60% | 91.03% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.38% | 91.11% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 84.38% | 96.61% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.17% | 97.09% |
| CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 82.55% | 98.99% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 82.52% | 96.38% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.51% | 100.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.03% | 92.94% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.30% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Callilepis salicifolia |
| Duhaldea cuspidata |
| PubChem | 390632 |
| LOTUS | LTS0209435 |
| wikiData | Q105371406 |