7-[4,5-Dihydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-2-yl]oxy-5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-3-methoxychromen-4-one
Internal ID | efc236d3-08f0-4d89-ae5f-dda0fc323e30 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 7-[4,5-dihydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-2-yl]oxy-5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-3-methoxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=CC(=C4C(=C3)OC(=C(C4=O)OC)C5=CC(=C(C=C5)OC)O)O)OC6C(C(C(C(O6)CO)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=CC(=C4C(=C3)OC(=C(C4=O)OC)C5=CC(=C(C=C5)OC)O)O)OC6C(C(C(C(O6)CO)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C35H44O21/c1-11-21(39)25(43)28(46)33(51-11)50-10-19-23(41)27(45)32(56-34-29(47)26(44)22(40)18(9-36)54-34)35(55-19)52-13-7-15(38)20-17(8-13)53-30(31(49-3)24(20)42)12-4-5-16(48-2)14(37)6-12/h4-8,11,18-19,21-23,25-29,32-41,43-47H,9-10H2,1-3H3 |
InChI Key | FMMWIUGZWKWZCS-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C35H44O21 |
Molecular Weight | 800.70 g/mol |
Exact Mass | 800.23750841 g/mol |
Topological Polar Surface Area (TPSA) | 323.00 Ų |
XlogP | -2.20 |
There are no found synonyms. |
![2D Structure of 7-[4,5-Dihydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-2-yl]oxy-5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-3-methoxychromen-4-one 2D Structure of 7-[4,5-Dihydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-2-yl]oxy-5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-3-methoxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/221601d0-830b-11ee-8805-d58322cd7c70.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.12% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.83% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.43% | 89.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.19% | 91.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.13% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 95.20% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.49% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.68% | 99.17% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 90.69% | 86.92% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.69% | 85.14% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.61% | 96.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.37% | 94.73% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 88.09% | 95.78% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.92% | 99.15% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.38% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.09% | 97.09% |
CHEMBL3194 | P02766 | Transthyretin | 84.64% | 90.71% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 84.20% | 96.21% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.78% | 94.45% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.94% | 90.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.82% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Bidens pilosa |
PubChem | 78393795 |
LOTUS | LTS0173615 |
wikiData | Q104997925 |