CID 139586995
| Internal ID | 8d0f0aa6-9f94-483a-aae9-231c8a6f6b53 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | (2S)-N-[(2R,8S,11R,12S,21R)-8-butan-2-yl-21-hydroxy-2-[(1S)-1-hydroxyethyl]-5-[(4-methoxyphenyl)methyl]-4,11-dimethyl-15-(2-methylpropyl)-3,6,9,13,16,22-hexaoxo-10-oxa-1,4,7,14,17-pentazabicyclo[16.3.1]docosan-12-yl]-2-[[(2S)-2-[[(2S)-2,3-dihydroxypropanoyl]amino]-4-(4-hydroxyphenyl)butanoyl]amino]pentanediamide |
| SMILES (Canonical) | CCC(C)C1C(=O)OC(C(C(=O)NC(C(=O)NC2CCC(N(C2=O)C(C(=O)N(C(C(=O)N1)CC3=CC=C(C=C3)OC)C)C(C)O)O)CC(C)C)NC(=O)C(CCC(=O)N)NC(=O)C(CCC4=CC=C(C=C4)O)NC(=O)C(CO)O)C |
| SMILES (Isomeric) | CCC(C)[C@H]1C(=O)O[C@@H]([C@@H](C(=O)NC(C(=O)NC2CC[C@H](N(C2=O)[C@@H](C(=O)N(C(C(=O)N1)CC3=CC=C(C=C3)OC)C)[C@H](C)O)O)CC(C)C)NC(=O)[C@H](CCC(=O)N)NC(=O)[C@H](CCC4=CC=C(C=C4)O)NC(=O)[C@H](CO)O)C |
| InChI | InChI=1S/C54H79N9O17/c1-9-28(4)43-54(78)80-30(6)44(61-47(71)36(20-22-41(55)68)56-46(70)35(57-50(74)40(67)26-64)19-14-31-10-15-33(66)16-11-31)51(75)59-38(24-27(2)3)48(72)58-37-21-23-42(69)63(52(37)76)45(29(5)65)53(77)62(7)39(49(73)60-43)25-32-12-17-34(79-8)18-13-32/h10-13,15-18,27-30,35-40,42-45,64-67,69H,9,14,19-26H2,1-8H3,(H2,55,68)(H,56,70)(H,57,74)(H,58,72)(H,59,75)(H,60,73)(H,61,71)/t28?,29-,30+,35-,36-,37?,38?,39?,40-,42+,43-,44-,45+/m0/s1 |
| InChI Key | WABVJCPIKZSXJF-YXHJYULMSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C54H79N9O17 |
| Molecular Weight | 1126.30 g/mol |
| Exact Mass | 1125.55939209 g/mol |
| Topological Polar Surface Area (TPSA) | 395.00 Ų |
| XlogP | 1.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.79% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.57% | 96.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.56% | 83.82% |
| CHEMBL3837 | P07711 | Cathepsin L | 98.96% | 96.61% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 98.33% | 97.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.27% | 94.45% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.36% | 99.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.74% | 91.11% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 95.93% | 95.89% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.42% | 95.56% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 94.79% | 97.14% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 93.68% | 94.66% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 93.49% | 95.89% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 93.11% | 93.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.29% | 93.56% |
| CHEMBL2000 | P03952 | Plasma kallikrein | 91.09% | 93.92% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 90.62% | 94.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 90.23% | 91.19% |
| CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 89.42% | 100.00% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 89.13% | 98.05% |
| CHEMBL4072 | P07858 | Cathepsin B | 88.92% | 93.67% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 88.36% | 95.00% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 87.63% | 85.00% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 87.17% | 95.93% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 86.47% | 90.08% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 85.92% | 97.64% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 85.91% | 98.59% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 85.72% | 92.32% |
| CHEMBL1801 | P00747 | Plasminogen | 85.49% | 92.44% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.75% | 89.00% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 84.66% | 97.33% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.62% | 86.33% |
| CHEMBL4330 | Q9NS75 | Cysteinyl leukotriene receptor 2 | 83.97% | 98.00% |
| CHEMBL1949 | P62937 | Cyclophilin A | 83.66% | 98.57% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 83.49% | 82.86% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 82.67% | 95.71% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 82.55% | 96.67% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.51% | 99.23% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.29% | 100.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.20% | 98.75% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.87% | 94.33% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.62% | 97.25% |
| CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 81.61% | 90.95% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.55% | 92.94% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.49% | 90.71% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 81.23% | 96.31% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 81.07% | 88.42% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 80.48% | 92.88% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.20% | 94.00% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 80.10% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139586995 |
| LOTUS | LTS0090257 |
| wikiData | Q77519024 |