2,2-Dimethyl-3-[3-(4-methylcyclohex-3-en-1-yl)but-3-en-1-yl]oxirane
Internal ID | 23aae781-6c88-4c0f-8580-8f1da50dd13b |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
IUPAC Name | 2,2-dimethyl-3-[3-(4-methylcyclohex-3-en-1-yl)but-3-enyl]oxirane |
SMILES (Canonical) | CC1=CCC(CC1)C(=C)CCC2C(O2)(C)C |
SMILES (Isomeric) | CC1=CCC(CC1)C(=C)CCC2C(O2)(C)C |
InChI | InChI=1S/C15H24O/c1-11-5-8-13(9-6-11)12(2)7-10-14-15(3,4)16-14/h5,13-14H,2,6-10H2,1,3-4H3 |
InChI Key | MGENYQSHSWSTRW-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H24O |
Molecular Weight | 220.35 g/mol |
Exact Mass | 220.182715385 g/mol |
Topological Polar Surface Area (TPSA) | 12.50 Ų |
XlogP | 3.90 |
DTXSID90750360 |
2,2-Dimethyl-3-[3-(4-methylcyclohex-3-en-1-yl)but-3-en-1-yl]oxirane |
![2D Structure of 2,2-Dimethyl-3-[3-(4-methylcyclohex-3-en-1-yl)but-3-en-1-yl]oxirane 2D Structure of 2,2-Dimethyl-3-[3-(4-methylcyclohex-3-en-1-yl)but-3-en-1-yl]oxirane](https://plantaedb.com/storage/docs/compounds/2023/11/22-dimethyl-3-3-4-methylcyclohex-3-en-1-ylbut-3-en-1-yloxirane.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.43% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.45% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.52% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.00% | 97.09% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 87.43% | 96.61% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.37% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.81% | 94.73% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.11% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.96% | 95.89% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.34% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 80.32% | 98.95% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 80.09% | 89.05% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Acritopappus confertus |
PubChem | 71320414 |
LOTUS | LTS0222565 |
wikiData | Q82700192 |