[(2R,3S,4R,5R,6R)-4,5,6-trihydroxy-2-[(3,4,5-trihydroxybenzoyl)oxymethyl]oxan-3-yl] 3,4,5-trihydroxy-2-(6,7,13,14-tetrahydroxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4(16),5,7,11,13-hexaen-5-yl)benzoate
Internal ID | 32187c91-a0c8-457c-8542-1708062ba5bf |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | [(2R,3S,4R,5R,6R)-4,5,6-trihydroxy-2-[(3,4,5-trihydroxybenzoyl)oxymethyl]oxan-3-yl] 3,4,5-trihydroxy-2-(6,7,13,14-tetrahydroxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4(16),5,7,11,13-hexaen-5-yl)benzoate |
SMILES (Canonical) | C1=C(C=C(C(=C1O)O)O)C(=O)OCC2C(C(C(C(O2)O)O)O)OC(=O)C3=CC(=C(C(=C3C4=C(C(=C5C6=C4C(=O)OC7=C6C(=CC(=C7O)O)C(=O)O5)O)O)O)O)O |
SMILES (Isomeric) | C1=C(C=C(C(=C1O)O)O)C(=O)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)O)O)O)OC(=O)C3=CC(=C(C(=C3C4=C(C(=C5C6=C4C(=O)OC7=C6C(=CC(=C7O)O)C(=O)O5)O)O)O)O)O |
InChI | InChI=1S/C34H24O22/c35-9-1-6(2-10(36)19(9)39)30(47)52-5-13-27(25(45)26(46)34(51)53-13)54-31(48)7-3-11(37)20(40)22(42)14(7)16-18-17-15-8(32(49)55-29(17)24(44)23(16)43)4-12(38)21(41)28(15)56-33(18)50/h1-4,13,25-27,34-46,51H,5H2/t13-,25-,26-,27-,34-/m1/s1 |
InChI Key | UKIPVDAOZKIZJT-NFWLSGPJSA-N |
Popularity | 0 references in papers |
Molecular Formula | C34H24O22 |
Molecular Weight | 784.50 g/mol |
Exact Mass | 784.07592239 g/mol |
Topological Polar Surface Area (TPSA) | 377.00 Ų |
XlogP | 0.00 |
There are no found synonyms. |
![2D Structure of [(2R,3S,4R,5R,6R)-4,5,6-trihydroxy-2-[(3,4,5-trihydroxybenzoyl)oxymethyl]oxan-3-yl] 3,4,5-trihydroxy-2-(6,7,13,14-tetrahydroxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4(16),5,7,11,13-hexaen-5-yl)benzoate 2D Structure of [(2R,3S,4R,5R,6R)-4,5,6-trihydroxy-2-[(3,4,5-trihydroxybenzoyl)oxymethyl]oxan-3-yl] 3,4,5-trihydroxy-2-(6,7,13,14-tetrahydroxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4(16),5,7,11,13-hexaen-5-yl)benzoate](https://plantaedb.com/storage/docs/compounds/2023/11/21dd3d40-8231-11ee-b044-7bc8c87a0819.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.51% | 91.11% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 96.19% | 95.17% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 96.15% | 89.34% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 95.42% | 91.49% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.05% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.65% | 89.00% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 93.64% | 95.64% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 93.31% | 83.00% |
CHEMBL3194 | P02766 | Transthyretin | 92.02% | 90.71% |
CHEMBL2581 | P07339 | Cathepsin D | 90.76% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.74% | 94.73% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 89.71% | 94.42% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.02% | 94.45% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.32% | 99.23% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.23% | 99.17% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.12% | 92.50% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.78% | 97.36% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.61% | 96.21% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.09% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Terminalia catappa |
Terminalia chebula |
PubChem | 101587736 |
LOTUS | LTS0093285 |
wikiData | Q105274579 |