(1S,2S,6R,7S,10R,12R,14S)-7-hydroxy-14-methyl-5,9-dimethylidene-3,13-dioxatetracyclo[8.4.0.02,6.012,14]tetradecan-4-one
| Internal ID | 61717941-93da-4a1a-b197-9b110af5a8e6 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Sesquiterpene lactones > Guaianolides and derivatives |
| IUPAC Name | (1S,2S,6R,7S,10R,12R,14S)-7-hydroxy-14-methyl-5,9-dimethylidene-3,13-dioxatetracyclo[8.4.0.02,6.012,14]tetradecan-4-one |
| SMILES (Canonical) | CC12C(O1)CC3C2C4C(C(CC3=C)O)C(=C)C(=O)O4 |
| SMILES (Isomeric) | C[C@]12[C@H](O1)C[C@@H]3[C@H]2[C@@H]4[C@@H]([C@H](CC3=C)O)C(=C)C(=O)O4 |
| InChI | InChI=1S/C15H18O4/c1-6-4-9(16)11-7(2)14(17)18-13(11)12-8(6)5-10-15(12,3)19-10/h8-13,16H,1-2,4-5H2,3H3/t8-,9-,10+,11+,12-,13-,15+/m0/s1 |
| InChI Key | KPUVIAXOGUUGET-QZNOIVSHSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12050905 g/mol |
| Topological Polar Surface Area (TPSA) | 59.10 Ų |
| XlogP | 0.90 |
| There are no found synonyms. |
![2D Structure of (1S,2S,6R,7S,10R,12R,14S)-7-hydroxy-14-methyl-5,9-dimethylidene-3,13-dioxatetracyclo[8.4.0.02,6.012,14]tetradecan-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/21c3e330-86af-11ee-abca-03143e8ee35b.jpg "2D Structure of (1S,2S,6R,7S,10R,12R,14S)-7-hydroxy-14-methyl-5,9-dimethylidene-3,13-dioxatetracyclo[8.4.0.02,6.012,14]tetradecan-4-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.76% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.44% | 91.11% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.73% | 90.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.39% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.07% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.33% | 97.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.30% | 99.23% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 85.18% | 97.79% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.10% | 89.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.64% | 97.25% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.62% | 95.89% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 82.60% | 85.11% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 82.17% | 96.61% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.53% | 100.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.92% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 80.48% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Leucanthemopsis pulverulenta |
| Tanacetum parthenium |
| PubChem | 14829076 |
| LOTUS | LTS0077583 |
| wikiData | Q105144394 |