(6R,7S,7aR)-6-[(3R,3aR,6R,6aR)-6-(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-7a-[4-[(3R,3aS,6S,6aS)-3-(4-hydroxy-3-methoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-2-methoxyphenoxy]-7-hydroxy-6,7-dihydro-1,3-benzodioxol-5-one
Internal ID | cc02874f-c838-4c5a-b130-cc7dd06a184b |
Taxonomy | Lignans, neolignans and related compounds > Furanoid lignans |
IUPAC Name | (6R,7S,7aR)-6-[(3R,3aR,6R,6aR)-6-(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-7a-[4-[(3R,3aS,6S,6aS)-3-(4-hydroxy-3-methoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-2-methoxyphenoxy]-7-hydroxy-6,7-dihydro-1,3-benzodioxol-5-one |
SMILES (Canonical) | COC1=C(C=C(C=C1)C2C3COC(C3CO2)C4C(C5(C(=CC4=O)OCO5)OC6=C(C=C(C=C6)C7C8COC(C8CO7)C9=CC(=C(C=C9)O)OC)OC)O)OC |
SMILES (Isomeric) | COC1=C(C=C(C=C1)[C@H]2[C@H]3CO[C@H]([C@H]3CO2)[C@H]4[C@@H]([C@@]5(C(=CC4=O)OCO5)OC6=C(C=C(C=C6)[C@@H]7[C@@H]8CO[C@H]([C@@H]8CO7)C9=CC(=C(C=C9)O)OC)OC)O)OC |
InChI | InChI=1S/C41H44O14/c1-45-29-9-6-21(12-32(29)47-3)38-25-17-52-39(26(25)18-51-38)35-28(43)14-34-41(40(35)44,54-19-53-34)55-30-10-7-22(13-33(30)48-4)37-24-16-49-36(23(24)15-50-37)20-5-8-27(42)31(11-20)46-2/h5-14,23-26,35-40,42,44H,15-19H2,1-4H3/t23-,24-,25+,26+,35+,36+,37-,38+,39-,40+,41-/m1/s1 |
InChI Key | RQIZMJRFMKUWCE-BGBXEHDGSA-N |
Popularity | 0 references in papers |
Molecular Formula | C41H44O14 |
Molecular Weight | 760.80 g/mol |
Exact Mass | 760.27310607 g/mol |
Topological Polar Surface Area (TPSA) | 159.00 Ų |
XlogP | 2.50 |
There are no found synonyms. |
![2D Structure of (6R,7S,7aR)-6-[(3R,3aR,6R,6aR)-6-(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-7a-[4-[(3R,3aS,6S,6aS)-3-(4-hydroxy-3-methoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-2-methoxyphenoxy]-7-hydroxy-6,7-dihydro-1,3-benzodioxol-5-one 2D Structure of (6R,7S,7aR)-6-[(3R,3aR,6R,6aR)-6-(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-7a-[4-[(3R,3aS,6S,6aS)-3-(4-hydroxy-3-methoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-2-methoxyphenoxy]-7-hydroxy-6,7-dihydro-1,3-benzodioxol-5-one](https://plantaedb.com/storage/docs/compounds/2023/11/219029a0-8552-11ee-b980-e136c284c626.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.46% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.95% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.71% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.82% | 96.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 94.72% | 92.94% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.63% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 91.59% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.00% | 97.09% |
CHEMBL2535 | P11166 | Glucose transporter | 90.81% | 98.75% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.33% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.94% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.75% | 94.45% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 84.83% | 89.62% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.23% | 99.23% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.02% | 100.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.19% | 97.14% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.97% | 91.19% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.88% | 99.15% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.69% | 92.62% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.23% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Zanthoxylum simulans |
PubChem | 163016047 |
LOTUS | LTS0235491 |
wikiData | Q105243348 |