2,12-Dimethyl-6-methylidene-9-propan-2-yltricyclo[8.4.0.01,5]tetradec-11-en-13-one
| Internal ID | 491d8738-ec96-441b-bbd1-5aed5f628482 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | 2,12-dimethyl-6-methylidene-9-propan-2-yltricyclo[8.4.0.01,5]tetradec-11-en-13-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C20H30O/c1-12(2)16-8-6-13(3)17-9-7-15(5)20(17)11-19(21)14(4)10-18(16)20/h10,12,15-18H,3,6-9,11H2,1-2,4-5H3 |
| InChI Key | CCZICCNXBIKTJO-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.229665576 g/mol |
| Topological Polar Surface Area (TPSA) | 17.10 Ų |
| XlogP | 5.20 |
| There are no found synonyms. |
![2D Structure of 2,12-Dimethyl-6-methylidene-9-propan-2-yltricyclo[8.4.0.01,5]tetradec-11-en-13-one](https://plantaedb.com/storage/docs/compounds/2023/11/212-dimethyl-6-methylidene-9-propan-2-yltricyclo840015tetradec-11-en-13-one.jpg "2D Structure of 2,12-Dimethyl-6-methylidene-9-propan-2-yltricyclo[8.4.0.01,5]tetradec-11-en-13-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 91.88% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.55% | 95.56% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 90.48% | 94.80% |
| CHEMBL4072 | P07858 | Cathepsin B | 89.91% | 93.67% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.13% | 97.25% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.14% | 94.75% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.94% | 96.47% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 86.68% | 93.04% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 85.36% | 86.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.02% | 90.71% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.88% | 91.11% |
| CHEMBL1871 | P10275 | Androgen Receptor | 84.79% | 96.43% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.12% | 99.23% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.12% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.52% | 95.89% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.36% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 73824057 |
| LOTUS | LTS0075806 |
| wikiData | Q103817620 |