2,10,11-trimethoxy-6-methyl-6-oxido-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-6-ium-1-ol
| Internal ID | 7417e2fe-aa7c-42b3-a10e-360b263608a3 |
| Taxonomy | Alkaloids and derivatives > Aporphines |
| IUPAC Name | 2,10,11-trimethoxy-6-methyl-6-oxido-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-6-ium-1-ol |
| SMILES (Canonical) | C[N+]1(CCC2=CC(=C(C3=C2C1CC4=C3C(=C(C=C4)OC)OC)O)OC)[O-] |
| SMILES (Isomeric) | C[N+]1(CCC2=CC(=C(C3=C2C1CC4=C3C(=C(C=C4)OC)OC)O)OC)[O-] |
| InChI | InChI=1S/C20H23NO5/c1-21(23)8-7-12-10-15(25-3)19(22)18-16(12)13(21)9-11-5-6-14(24-2)20(26-4)17(11)18/h5-6,10,13,22H,7-9H2,1-4H3 |
| InChI Key | IOQVEMNCFHPMHA-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.15762283 g/mol |
| Topological Polar Surface Area (TPSA) | 66.00 Ų |
| XlogP | 2.50 |
| AKOS040737407 |
![2D Structure of 2,10,11-trimethoxy-6-methyl-6-oxido-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-6-ium-1-ol](https://plantaedb.com/storage/docs/compounds/2023/11/21011-trimethoxy-6-methyl-6-oxido-566a7-tetrahydro-4h-dibenzodegquinolin-6-ium-1-ol.jpg "2D Structure of 2,10,11-trimethoxy-6-methyl-6-oxido-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-6-ium-1-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.58% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.31% | 91.11% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 92.91% | 93.99% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 92.90% | 91.49% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.13% | 94.45% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 92.07% | 95.62% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 91.50% | 92.94% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.74% | 95.56% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 88.49% | 88.48% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.35% | 99.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.74% | 86.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.83% | 95.89% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.70% | 94.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.46% | 98.75% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 86.03% | 91.00% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 85.25% | 92.68% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 84.92% | 91.79% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.45% | 98.95% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 84.44% | 93.40% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.82% | 95.89% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 83.20% | 89.62% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.87% | 85.14% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.77% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Glaucium fimbrilligerum |
| PubChem | 146116230 |
| LOTUS | LTS0235804 |
| wikiData | Q104394350 |