2,10,10-Trimethyl-7-methylidenetricyclo[6.3.0.01,5]undecane
| Internal ID | 377b3ea5-b462-406d-aba2-60b3565950ec |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Triquinane sesquiterpenoids > Angular triquinanes |
| IUPAC Name | 2,10,10-trimethyl-7-methylidenetricyclo[6.3.0.01,5]undecane |
| SMILES (Canonical) | CC1CCC2C13CC(CC3C(=C)C2)(C)C |
| SMILES (Isomeric) | CC1CCC2C13CC(CC3C(=C)C2)(C)C |
| InChI | InChI=1S/C15H24/c1-10-7-12-6-5-11(2)15(12)9-14(3,4)8-13(10)15/h11-13H,1,5-9H2,2-4H3 |
| InChI Key | CPNKKZQGNNFQGD-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.35 g/mol |
| Exact Mass | 204.187800766 g/mol |
| Topological Polar Surface Area (TPSA) | 0.00 Ų |
| XlogP | 4.90 |
| There are no found synonyms. |
![2D Structure of 2,10,10-Trimethyl-7-methylidenetricyclo[6.3.0.01,5]undecane](https://plantaedb.com/storage/docs/compounds/2023/11/21010-trimethyl-7-methylidenetricyclo630015undecane.jpg "2D Structure of 2,10,10-Trimethyl-7-methylidenetricyclo[6.3.0.01,5]undecane")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.83% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.58% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.83% | 97.25% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.28% | 97.09% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 84.65% | 86.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.05% | 95.89% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 83.05% | 85.11% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.81% | 100.00% |
| CHEMBL5600 | P27448 | Serine/threonine-protein kinase c-TAK1 | 81.06% | 88.81% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Lophozia ventricosa |
| PubChem | 73806537 |
| LOTUS | LTS0134868 |
| wikiData | Q104967660 |