(3S,8R,9S,13R)-9-ethyl-4,4,13,14-tetramethyl-17-(6-methylheptan-2-yl)-2,3,5,6,7,8,10,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol
Internal ID | a4aef0d0-f25c-4835-adc0-0fe774fb77c6 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Cucurbitacins |
IUPAC Name | (3S,8R,9S,13R)-9-ethyl-4,4,13,14-tetramethyl-17-(6-methylheptan-2-yl)-2,3,5,6,7,8,10,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
SMILES (Canonical) | CCC12CCC3(C(CCC3(C1CCC4C2CCC(C4(C)C)O)C)C(C)CCCC(C)C)C |
SMILES (Isomeric) | CC[C@@]12CC[C@@]3(C(CCC3([C@@H]1CCC4C2CC[C@@H](C4(C)C)O)C)C(C)CCCC(C)C)C |
InChI | InChI=1S/C31H56O/c1-9-31-20-19-29(7)23(22(4)12-10-11-21(2)3)17-18-30(29,8)26(31)15-13-24-25(31)14-16-27(32)28(24,5)6/h21-27,32H,9-20H2,1-8H3/t22?,23?,24?,25?,26-,27-,29+,30?,31-/m0/s1 |
InChI Key | RRTBTJPVUGMUNR-FDBZVDBOSA-N |
Popularity | 0 references in papers |
Molecular Formula | C31H56O |
Molecular Weight | 444.80 g/mol |
Exact Mass | 444.433116406 g/mol |
Topological Polar Surface Area (TPSA) | 20.20 Ų |
XlogP | 11.10 |
There are no found synonyms. |
![2D Structure of (3S,8R,9S,13R)-9-ethyl-4,4,13,14-tetramethyl-17-(6-methylheptan-2-yl)-2,3,5,6,7,8,10,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol 2D Structure of (3S,8R,9S,13R)-9-ethyl-4,4,13,14-tetramethyl-17-(6-methylheptan-2-yl)-2,3,5,6,7,8,10,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol](https://plantaedb.com/storage/docs/compounds/2023/11/20e797c0-85ed-11ee-a034-2f72f80e6fdf.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.47% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.26% | 97.25% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 94.92% | 95.93% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.62% | 94.45% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 93.40% | 82.69% |
CHEMBL2581 | P07339 | Cathepsin D | 92.79% | 98.95% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 91.95% | 96.38% |
CHEMBL3837 | P07711 | Cathepsin L | 91.89% | 96.61% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 91.10% | 100.00% |
CHEMBL236 | P41143 | Delta opioid receptor | 91.08% | 99.35% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 89.66% | 92.86% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.44% | 97.09% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 88.34% | 92.98% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.08% | 90.71% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 88.03% | 97.29% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 87.89% | 95.58% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.82% | 90.17% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 87.77% | 96.47% |
CHEMBL1907 | P15144 | Aminopeptidase N | 87.32% | 93.31% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.57% | 93.56% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 86.50% | 97.79% |
CHEMBL233 | P35372 | Mu opioid receptor | 85.31% | 97.93% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.83% | 95.89% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.53% | 95.89% |
CHEMBL5646 | Q6L5J4 | FML2_HUMAN | 84.31% | 100.00% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 84.24% | 85.31% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 83.70% | 97.50% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 83.48% | 92.88% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.25% | 100.00% |
CHEMBL268 | P43235 | Cathepsin K | 83.14% | 96.85% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.12% | 93.00% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 82.45% | 96.61% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.34% | 100.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.14% | 94.75% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 80.78% | 97.86% |
CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 80.70% | 95.00% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 80.44% | 91.03% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.28% | 90.08% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 80.12% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 5316233 |
LOTUS | LTS0199504 |
wikiData | Q105244336 |