9-[4,6-Dihydroxy-8,16-bis(4-hydroxyphenyl)-12-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-15-oxatetracyclo[8.6.1.02,7.014,17]heptadeca-2(7),3,5,10(17),11,13-hexaen-9-yl]-8,16-bis(4-hydroxyphenyl)-15-oxatetracyclo[8.6.1.02,7.014,17]heptadeca-2(7),3,5,10(17),11,13-hexaene-4,6,12-triol
Internal ID | 61c77a2a-1c05-4689-aee3-bc8613a4103b |
Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
IUPAC Name | 9-[4,6-dihydroxy-8,16-bis(4-hydroxyphenyl)-12-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-15-oxatetracyclo[8.6.1.02,7.014,17]heptadeca-2(7),3,5,10(17),11,13-hexaen-9-yl]-8,16-bis(4-hydroxyphenyl)-15-oxatetracyclo[8.6.1.02,7.014,17]heptadeca-2(7),3,5,10(17),11,13-hexaene-4,6,12-triol |
SMILES (Canonical) | C1=CC(=CC=C1C2C(C3=C4C(C(OC4=CC(=C3)O)C5=CC=C(C=C5)O)C6=C2C(=CC(=C6)O)O)C7C(C8=C(C=C(C=C8O)O)C9C(OC1=CC(=CC7=C91)OC1C(C(C(C(O1)CO)O)O)O)C1=CC=C(C=C1)O)C1=CC=C(C=C1)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1C2C(C3=C4C(C(OC4=CC(=C3)O)C5=CC=C(C=C5)O)C6=C2C(=CC(=C6)O)O)C7C(C8=C(C=C(C=C8O)O)C9C(OC1=CC(=CC7=C91)OC1C(C(C(C(O1)CO)O)O)O)C1=CC=C(C=C1)O)C1=CC=C(C=C1)O)O |
InChI | InChI=1S/C62H52O17/c63-25-46-57(73)58(74)59(75)62(79-46)76-37-23-41-52-45(24-37)78-61(29-7-15-33(67)16-8-29)56(52)39-18-35(69)21-43(72)50(39)48(27-3-11-31(65)12-4-27)54(41)53-40-19-36(70)22-44-51(40)55(60(77-44)28-5-13-32(66)14-6-28)38-17-34(68)20-42(71)49(38)47(53)26-1-9-30(64)10-2-26/h1-24,46-48,53-75H,25H2 |
InChI Key | LUHKEQAQZMTBRZ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C62H52O17 |
Molecular Weight | 1069.10 g/mol |
Exact Mass | 1068.32045019 g/mol |
Topological Polar Surface Area (TPSA) | 300.00 Ų |
XlogP | 7.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.52% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.28% | 96.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 94.79% | 99.15% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.96% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 90.68% | 98.95% |
CHEMBL4208 | P20618 | Proteasome component C5 | 89.54% | 90.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.47% | 89.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 88.07% | 95.93% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.58% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.48% | 94.73% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 85.17% | 97.33% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 82.69% | 95.78% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 82.12% | 97.36% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.87% | 94.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.22% | 95.89% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 80.52% | 85.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.02% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Erythrina berteroana |
Erythrina crista-galli |
Erythrina fusca |
Erythrina latissima |
Erythrina melanacantha |
Erythrina speciosa |
Erythrina variegata |
Erythrina velutina |
Hopea parviflora |
PubChem | 75244299 |
LOTUS | LTS0248116 |
wikiData | Q105113174 |