[(2R,3S,4S,6S)-6-[(23E,27E,31E)-36-[3-[3-[(3-but-3-enyloxiran-2-yl)methyl]but-3-enyl]oxiran-2-yl]-1,4,8-trihydroxy-21,25-dimethyl-6,14-dioxo-10-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxyhexatriaconta-23,27,31-trienyl]-4-hydroxy-2-(2-hydroxypropyl)oxan-3-yl] hydrogen sulfate
| Internal ID | 6643b726-0d9f-4605-a21b-5d823abee8a3 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acyl glycosides > Fatty acyl glycosides of mono- and disaccharides |
| IUPAC Name | [(2R,3S,4S,6S)-6-[(23E,27E,31E)-36-[3-[3-[(3-but-3-enyloxiran-2-yl)methyl]but-3-enyl]oxiran-2-yl]-1,4,8-trihydroxy-21,25-dimethyl-6,14-dioxo-10-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxyhexatriaconta-23,27,31-trienyl]-4-hydroxy-2-(2-hydroxypropyl)oxan-3-yl] hydrogen sulfate |
| SMILES (Canonical) | CC(CCCCCCC(=O)CCCC(CC(CC(=O)CC(CCC(C1CC(C(C(O1)CC(C)O)OS(=O)(=O)O)O)O)O)O)OC2C(C(C(C(O2)COC3C(C(C(C(O3)CO)O)O)O)O)O)O)CC=CC(C)CC=CCCC=CCCCCC4C(O4)CCC(=C)CC5C(O5)CCC=C |
| SMILES (Isomeric) | CC(CCCCCCC(=O)CCCC(CC(CC(=O)CC(CCC([C@@H]1C[C@@H]([C@@H]([C@H](O1)CC(C)O)OS(=O)(=O)O)O)O)O)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O)O)O)C/C=C/C(C)C/C=C/CC/C=C/CCCCC4C(O4)CCC(=C)CC5C(O5)CCC=C |
| InChI | InChI=1S/C71H120O25S/c1-6-7-30-56-59(92-56)36-46(4)32-35-57-55(91-57)31-20-14-12-10-8-9-11-13-17-23-44(2)25-21-26-45(3)24-18-15-16-19-27-48(74)28-22-29-52(90-71-68(85)66(83)64(81)62(95-71)43-89-70-67(84)65(82)63(80)61(42-72)94-70)40-51(77)39-50(76)38-49(75)33-34-53(78)58-41-54(79)69(96-97(86,87)88)60(93-58)37-47(5)73/h6,8,10,13,17,21,25,44-45,47,49,51-73,75,77-85H,1,4,7,9,11-12,14-16,18-20,22-24,26-43H2,2-3,5H3,(H,86,87,88)/b10-8+,17-13+,25-21+/t44?,45?,47?,49?,51?,52?,53?,54-,55?,56?,57?,58-,59?,60+,61+,62+,63+,64+,65-,66-,67+,68+,69-,70+,71+/m0/s1 |
| InChI Key | LVWHMDYJKBEFPO-UOFXMMITSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C71H120O25S |
| Molecular Weight | 1405.80 g/mol |
| Exact Mass | 1404.78394048 g/mol |
| Topological Polar Surface Area (TPSA) | 420.00 Ų |
| XlogP | 5.10 |
| Atomic LogP (AlogP) | 5.44 |
| H-Bond Acceptor | 24 |
| H-Bond Donor | 13 |
| Rotatable Bonds | 52 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.4698 | 46.98% |
| Caco-2 | - | 0.8610 | 86.10% |
| Blood Brain Barrier | - | 0.5000 | 50.00% |
| Human oral bioavailability | - | 0.7857 | 78.57% |
| Subcellular localzation | Mitochondria | 0.5743 | 57.43% |
| OATP2B1 inhibitior | - | 0.8670 | 86.70% |
| OATP1B1 inhibitior | + | 0.8038 | 80.38% |
| OATP1B3 inhibitior | + | 0.9292 | 92.92% |
| MATE1 inhibitior | - | 0.9612 | 96.12% |
| OCT2 inhibitior | - | 0.6776 | 67.76% |
| BSEP inhibitior | + | 0.9937 | 99.37% |
| P-glycoprotein inhibitior | + | 0.7422 | 74.22% |
| P-glycoprotein substrate | + | 0.8122 | 81.22% |
| CYP3A4 substrate | + | 0.7540 | 75.40% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8670 | 86.70% |
| CYP3A4 inhibition | - | 0.6471 | 64.71% |
| CYP2C9 inhibition | - | 0.7292 | 72.92% |
| CYP2C19 inhibition | - | 0.6861 | 68.61% |
| CYP2D6 inhibition | - | 0.8632 | 86.32% |
| CYP1A2 inhibition | - | 0.7154 | 71.54% |
| CYP2C8 inhibition | + | 0.8122 | 81.22% |
| CYP inhibitory promiscuity | - | 0.9515 | 95.15% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.6000 | 60.00% |
| Carcinogenicity (trinary) | Non-required | 0.6094 | 60.94% |
| Eye corrosion | - | 0.9753 | 97.53% |
| Eye irritation | - | 0.8985 | 89.85% |
| Skin irritation | - | 0.7545 | 75.45% |
| Skin corrosion | - | 0.9052 | 90.52% |
| Ames mutagenesis | - | 0.6478 | 64.78% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.8552 | 85.52% |
| Micronuclear | + | 0.5700 | 57.00% |
| Hepatotoxicity | - | 0.5625 | 56.25% |
| skin sensitisation | - | 0.8156 | 81.56% |
| Respiratory toxicity | + | 0.5444 | 54.44% |
| Reproductive toxicity | + | 0.6333 | 63.33% |
| Mitochondrial toxicity | + | 0.6250 | 62.50% |
| Nephrotoxicity | - | 0.7440 | 74.40% |
| Acute Oral Toxicity (c) | III | 0.6013 | 60.13% |
| Estrogen receptor binding | + | 0.8197 | 81.97% |
| Androgen receptor binding | + | 0.7350 | 73.50% |
| Thyroid receptor binding | + | 0.6235 | 62.35% |
| Glucocorticoid receptor binding | + | 0.7480 | 74.80% |
| Aromatase binding | + | 0.5512 | 55.12% |
| PPAR gamma | + | 0.8079 | 80.79% |
| Honey bee toxicity | - | 0.6003 | 60.03% |
| Biodegradation | - | 0.7500 | 75.00% |
| Crustacea aquatic toxicity | - | 0.5700 | 57.00% |
| Fish aquatic toxicity | + | 0.9890 | 98.90% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL220 | P22303 | Acetylcholinesterase | 99.88% | 94.45% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 97.84% | 96.47% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.95% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.93% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.92% | 96.09% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 96.51% | 95.71% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 95.82% | 98.75% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.45% | 91.11% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 95.03% | 92.50% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 94.66% | 97.29% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 94.58% | 85.94% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 93.87% | 91.19% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 93.79% | 94.66% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.56% | 97.25% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 92.84% | 92.32% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 92.80% | 85.31% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 92.47% | 91.49% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.35% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.06% | 97.09% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 90.92% | 95.92% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 90.88% | 95.50% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.43% | 95.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.36% | 96.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.54% | 94.73% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.03% | 95.89% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 88.93% | 95.00% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 88.87% | 96.38% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 88.52% | 96.90% |
| CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 88.20% | 92.38% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 88.15% | 100.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 88.11% | 93.56% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 86.74% | 97.47% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.64% | 96.95% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 86.41% | 97.21% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 86.12% | 82.50% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.82% | 96.61% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 85.59% | 94.33% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 85.20% | 100.00% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 85.15% | 96.77% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.14% | 100.00% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 84.54% | 95.83% |
| CHEMBL1993 | P26358 | DNA (cytosine-5)-methyltransferase 1 | 84.53% | 95.44% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.15% | 89.00% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 82.85% | 92.88% |
| CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 82.61% | 96.37% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 82.58% | 89.44% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 82.55% | 90.08% |
| CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 82.53% | 94.97% |
| CHEMBL4015 | P41597 | C-C chemokine receptor type 2 | 82.34% | 98.57% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 80.84% | 91.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Lindera erythrocarpa |
| PubChem | 10034454 |
| LOTUS | LTS0027895 |
| wikiData | Q105120825 |