3-(4-hydroxyphenyl)-1-[4-methoxy-3,5-bis[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]phenyl]propan-1-one
Internal ID | 8eb5885e-6056-4d44-9b00-9b1b186d85af |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides |
IUPAC Name | 3-(4-hydroxyphenyl)-1-[4-methoxy-3,5-bis[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]phenyl]propan-1-one |
SMILES (Canonical) | COC1=C(C=C(C=C1OC2C(C(C(C(O2)CO)O)O)O)C(=O)CCC3=CC=C(C=C3)O)OC4C(C(C(C(O4)CO)O)O)O |
SMILES (Isomeric) | COC1=C(C=C(C=C1O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)C(=O)CCC3=CC=C(C=C3)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O |
InChI | InChI=1S/C28H36O15/c1-39-26-16(40-27-24(37)22(35)20(33)18(10-29)42-27)8-13(15(32)7-4-12-2-5-14(31)6-3-12)9-17(26)41-28-25(38)23(36)21(34)19(11-30)43-28/h2-3,5-6,8-9,18-25,27-31,33-38H,4,7,10-11H2,1H3/t18-,19-,20-,21-,22+,23+,24-,25-,27-,28-/m1/s1 |
InChI Key | OKMGWOUOWVCUHL-DPOJTEBASA-N |
Popularity | 1 reference in papers |
Molecular Formula | C28H36O15 |
Molecular Weight | 612.60 g/mol |
Exact Mass | 612.20542044 g/mol |
Topological Polar Surface Area (TPSA) | 245.00 Ų |
XlogP | -1.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.64% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.27% | 99.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.31% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.67% | 86.33% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 90.65% | 96.95% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.84% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 88.45% | 98.95% |
CHEMBL2535 | P11166 | Glucose transporter | 88.11% | 98.75% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 88.05% | 85.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.32% | 94.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.73% | 90.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.80% | 94.73% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.48% | 95.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.53% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.67% | 95.56% |
CHEMBL220 | P22303 | Acetylcholinesterase | 81.78% | 94.45% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.61% | 96.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.47% | 95.89% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 80.97% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Pieris japonica |
PubChem | 11342511 |
LOTUS | LTS0076090 |
wikiData | Q105193641 |