[(3R,4R,5R,7S,10R,12R)-4,11,12-triacetyloxy-1-hydroxy-10,14,17-trimethyl-6-methylidene-16-oxatetracyclo[11.3.1.03,14.05,10]heptadec-13(17)-en-7-yl] (E)-3-phenylprop-2-enoate
Internal ID | f6a7dd51-1b71-4709-a3cb-ad4b5075114f |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Tetracarboxylic acids and derivatives |
IUPAC Name | [(3R,4R,5R,7S,10R,12R)-4,11,12-triacetyloxy-1-hydroxy-10,14,17-trimethyl-6-methylidene-16-oxatetracyclo[11.3.1.03,14.05,10]heptadec-13(17)-en-7-yl] (E)-3-phenylprop-2-enoate |
SMILES (Canonical) | CC1=C2C(C(C3(CCC(C(=C)C3C(C4C2(COC1(C4)O)C)OC(=O)C)OC(=O)C=CC5=CC=CC=C5)C)OC(=O)C)OC(=O)C |
SMILES (Isomeric) | CC1=C2[C@H](C([C@@]3(CC[C@@H](C(=C)[C@H]3[C@@H]([C@H]4C2(COC1(C4)O)C)OC(=O)C)OC(=O)/C=C/C5=CC=CC=C5)C)OC(=O)C)OC(=O)C |
InChI | InChI=1S/C35H42O10/c1-19-26(45-27(39)14-13-24-11-9-8-10-12-24)15-16-33(6)28(19)30(42-21(3)36)25-17-35(40)20(2)29(34(25,7)18-41-35)31(43-22(4)37)32(33)44-23(5)38/h8-14,25-26,28,30-32,40H,1,15-18H2,2-7H3/b14-13+/t25-,26-,28-,30+,31+,32?,33+,34?,35?/m0/s1 |
InChI Key | CEAAWQZVSISBFI-NFLJKZLJSA-N |
Popularity | 0 references in papers |
Molecular Formula | C35H42O10 |
Molecular Weight | 622.70 g/mol |
Exact Mass | 622.27779753 g/mol |
Topological Polar Surface Area (TPSA) | 135.00 Ų |
XlogP | 3.10 |
There are no found synonyms. |
![2D Structure of [(3R,4R,5R,7S,10R,12R)-4,11,12-triacetyloxy-1-hydroxy-10,14,17-trimethyl-6-methylidene-16-oxatetracyclo[11.3.1.03,14.05,10]heptadec-13(17)-en-7-yl] (E)-3-phenylprop-2-enoate 2D Structure of [(3R,4R,5R,7S,10R,12R)-4,11,12-triacetyloxy-1-hydroxy-10,14,17-trimethyl-6-methylidene-16-oxatetracyclo[11.3.1.03,14.05,10]heptadec-13(17)-en-7-yl] (E)-3-phenylprop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/209e2890-85d1-11ee-bbe0-279d80311daf.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.47% | 86.33% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 97.35% | 90.17% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 95.97% | 93.99% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.64% | 91.11% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 95.58% | 94.62% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 95.47% | 95.50% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.20% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.69% | 96.09% |
CHEMBL5028 | O14672 | ADAM10 | 90.07% | 97.50% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 89.44% | 91.49% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.64% | 96.00% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 88.38% | 94.08% |
CHEMBL2581 | P07339 | Cathepsin D | 86.98% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.35% | 94.45% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.61% | 93.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.03% | 99.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.82% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.03% | 97.09% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.90% | 100.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.85% | 100.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.94% | 91.19% |
CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 80.88% | 96.25% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.24% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Taxus cuspidata |
PubChem | 6326128 |
LOTUS | LTS0060264 |
wikiData | Q105102347 |