2,3,6-Trichloro-5-hydroxy-8-methyl-1-[4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]chromeno[2,3-b]pyrrol-4-one
| Internal ID | 9771bab2-2fa6-40c1-8f75-ca36305bedf5 |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Chromones |
| IUPAC Name | 2,3,6-trichloro-5-hydroxy-8-methyl-1-[4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]chromeno[2,3-b]pyrrol-4-one |
| SMILES (Canonical) | CC1=CC(=C(C2=C1OC3=C(C2=O)C(=C(N3C4C=C(C(C(C4O)O)O)CO)Cl)Cl)O)Cl |
| SMILES (Isomeric) | CC1=CC(=C(C2=C1OC3=C(C2=O)C(=C(N3C4C=C(C(C(C4O)O)O)CO)Cl)Cl)O)Cl |
| InChI | InChI=1S/C19H16Cl3NO7/c1-5-2-7(20)13(26)10-15(28)9-11(21)18(22)23(19(9)30-17(5)10)8-3-6(4-24)12(25)16(29)14(8)27/h2-3,8,12,14,16,24-27,29H,4H2,1H3 |
| InChI Key | UMYLEZLFZDFTNY-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H16Cl3NO7 |
| Molecular Weight | 476.70 g/mol |
| Exact Mass | 474.999235 g/mol |
| Topological Polar Surface Area (TPSA) | 132.00 Ų |
| XlogP | 2.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.73% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.79% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 93.64% | 94.73% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.23% | 89.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.86% | 94.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.30% | 95.56% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 88.85% | 89.34% |
| CHEMBL204 | P00734 | Thrombin | 87.66% | 96.01% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.85% | 86.33% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 85.75% | 86.92% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 85.66% | 89.62% |
| CHEMBL4530 | P00488 | Coagulation factor XIII | 80.87% | 96.00% |
| CHEMBL5905 | Q04828 | Aldo-keto reductase family 1 member C1 | 80.47% | 91.79% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.45% | 94.42% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.17% | 96.09% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 80.03% | 96.90% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10344935 |
| LOTUS | LTS0190878 |
| wikiData | Q104198386 |