(3S,8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methylhept-6-en-2-yl]-3-hydroxy-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-one
Internal ID | d612cab7-fdf4-4a99-a6bd-aee5a6309a73 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Stigmastanes and derivatives |
IUPAC Name | (3S,8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methylhept-6-en-2-yl]-3-hydroxy-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-one |
SMILES (Canonical) | CCC(CCC(C)C1CCC2C1(CCC3C2C(=O)C=C4C3(CCC(C4)O)C)C)C(=C)C |
SMILES (Isomeric) | CC[C@H](CC[C@@H](C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2C(=O)C=C4[C@@]3(CC[C@@H](C4)O)C)C)C(=C)C |
InChI | InChI=1S/C29H46O2/c1-7-20(18(2)3)9-8-19(4)23-10-11-24-27-25(13-15-29(23,24)6)28(5)14-12-22(30)16-21(28)17-26(27)31/h17,19-20,22-25,27,30H,2,7-16H2,1,3-6H3/t19-,20-,22+,23-,24+,25+,27+,28+,29-/m1/s1 |
InChI Key | HBBIPORYGNULJF-ZIHMWMKCSA-N |
Popularity | 0 references in papers |
Molecular Formula | C29H46O2 |
Molecular Weight | 426.70 g/mol |
Exact Mass | 426.349780706 g/mol |
Topological Polar Surface Area (TPSA) | 37.30 Ų |
XlogP | 8.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.48% | 97.25% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 97.23% | 95.93% |
CHEMBL2581 | P07339 | Cathepsin D | 96.52% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.02% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.15% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.62% | 91.11% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 92.53% | 100.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 91.64% | 90.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.88% | 95.89% |
CHEMBL1871 | P10275 | Androgen Receptor | 87.39% | 96.43% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.26% | 97.09% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 86.58% | 93.04% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 85.17% | 82.69% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.93% | 89.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.75% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.91% | 95.56% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.96% | 90.17% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.61% | 93.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.52% | 86.33% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.40% | 93.56% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 81.20% | 94.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Momordica charantia |
Teucrium chamaedrys subsp. chamaedrys |
PubChem | 101664456 |
LOTUS | LTS0169006 |
wikiData | Q105025186 |