5,7-dihydroxy-2-(4-hydroxyphenyl)-6,8-bis[(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one
Internal ID | 911ec30a-f551-4957-87d9-bc0aa5e51a30 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid C-glycosides > Flavonoid 8-C-glycosides |
IUPAC Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-6,8-bis[(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one |
SMILES (Canonical) | C1=CC(=CC=C1C2=CC(=O)C3=C(C(=C(C(=C3O2)C4C(C(C(C(O4)CO)O)O)O)O)C5C(C(C(C(O5)CO)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1C2=CC(=O)C3=C(C(=C(C(=C3O2)[C@H]4[C@H]([C@@H]([C@H]([C@@H](O4)CO)O)O)O)O)[C@H]5[C@H]([C@@H]([C@H]([C@@H](O5)CO)O)O)O)O)O |
InChI | InChI=1S/C27H30O15/c28-6-12-17(32)21(36)23(38)26(41-12)15-19(34)14-10(31)5-11(8-1-3-9(30)4-2-8)40-25(14)16(20(15)35)27-24(39)22(37)18(33)13(7-29)42-27/h1-5,12-13,17-18,21-24,26-30,32-39H,6-7H2/t12-,13-,17-,18-,21+,22+,23-,24-,26-,27-/m0/s1 |
InChI Key | FIAAVMJLAGNUKW-QHAUNTTASA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H30O15 |
Molecular Weight | 594.50 g/mol |
Exact Mass | 594.15847025 g/mol |
Topological Polar Surface Area (TPSA) | 267.00 Ų |
XlogP | -2.30 |
There are no found synonyms. |
![2D Structure of 5,7-dihydroxy-2-(4-hydroxyphenyl)-6,8-bis[(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one 2D Structure of 5,7-dihydroxy-2-(4-hydroxyphenyl)-6,8-bis[(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/201483f0-842f-11ee-84b0-3deb4b5adbfc.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.35% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 98.05% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.61% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.73% | 94.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.61% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.95% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.89% | 95.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.20% | 99.15% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 85.69% | 86.92% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.08% | 97.09% |
CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 82.75% | 89.23% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 82.70% | 96.21% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.26% | 99.17% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 81.97% | 91.71% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 81.76% | 93.10% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.13% | 90.71% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 80.62% | 98.35% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 80.51% | 85.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Anethum graveolens |
PubChem | 162845825 |
LOTUS | LTS0099785 |
wikiData | Q104995560 |