2-[(Z)-1-hydroxybut-2-en-2-yl]-3-(hydroxymethyl)-7,12-dihydro-6H-indolo[2,3-a]quinolizin-4-one
| Internal ID | 4bc175ad-7a4d-4a1d-958d-c83bd8e10be5 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Pyridoindoles > Beta carbolines |
| IUPAC Name | 2-[(Z)-1-hydroxybut-2-en-2-yl]-3-(hydroxymethyl)-7,12-dihydro-6H-indolo[2,3-a]quinolizin-4-one |
| SMILES (Canonical) | CC=C(CO)C1=C(C(=O)N2CCC3=C(C2=C1)NC4=CC=CC=C34)CO |
| SMILES (Isomeric) | C/C=C(\CO)/C1=C(C(=O)N2CCC3=C(C2=C1)NC4=CC=CC=C34)CO |
| InChI | InChI=1S/C20H20N2O3/c1-2-12(10-23)15-9-18-19-14(13-5-3-4-6-17(13)21-19)7-8-22(18)20(25)16(15)11-24/h2-6,9,21,23-24H,7-8,10-11H2,1H3/b12-2+ |
| InChI Key | FIELJMSNCWUFSW-SWGQDTFXSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.14739250 g/mol |
| Topological Polar Surface Area (TPSA) | 76.60 Ų |
| XlogP | 1.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.06% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 98.05% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.57% | 91.11% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 95.03% | 93.40% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 93.59% | 91.71% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.32% | 96.09% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 92.94% | 88.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.31% | 85.14% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.20% | 89.00% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 89.72% | 98.59% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.14% | 93.99% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.40% | 98.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.36% | 86.33% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 84.44% | 90.08% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.16% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 12047481 |
| LOTUS | LTS0077080 |
| wikiData | Q104995655 |