2-Undec-10-enylphenanthrene
Internal ID | 7465fb52-e8c9-4dc2-9088-aed2cd9e2394 |
Taxonomy | Benzenoids > Phenanthrenes and derivatives |
IUPAC Name | 2-undec-10-enylphenanthrene |
SMILES (Canonical) | C=CCCCCCCCCCC1=CC2=C(C=C1)C3=CC=CC=C3C=C2 |
SMILES (Isomeric) | C=CCCCCCCCCCC1=CC2=C(C=C1)C3=CC=CC=C3C=C2 |
InChI | InChI=1S/C25H30/c1-2-3-4-5-6-7-8-9-10-13-21-16-19-25-23(20-21)18-17-22-14-11-12-15-24(22)25/h2,11-12,14-20H,1,3-10,13H2 |
InChI Key | LCGUYDCJPRVNCX-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H30 |
Molecular Weight | 330.50 g/mol |
Exact Mass | 330.234750957 g/mol |
Topological Polar Surface Area (TPSA) | 0.00 Ų |
XlogP | 9.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL240 | Q12809 | HERG | 99.20% | 89.76% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.44% | 91.11% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 91.81% | 92.08% |
CHEMBL2581 | P07339 | Cathepsin D | 91.78% | 98.95% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 91.73% | 91.49% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 90.81% | 85.94% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 90.79% | 95.00% |
CHEMBL2039 | P27338 | Monoamine oxidase B | 88.43% | 92.51% |
CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 87.82% | 93.81% |
CHEMBL2885 | P07451 | Carbonic anhydrase III | 87.70% | 87.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.67% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.41% | 95.56% |
CHEMBL4296013 | Q5VWK5 | Interleukin-23 receptor | 86.98% | 88.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.65% | 86.33% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 84.76% | 83.57% |
CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 83.80% | 96.25% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.35% | 94.73% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.28% | 95.50% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.94% | 93.99% |
CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 82.24% | 85.49% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.22% | 91.71% |
CHEMBL3959 | P16083 | Quinone reductase 2 | 81.15% | 89.49% |
CHEMBL3891 | P07384 | Calpain 1 | 81.13% | 93.04% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Kalanchoe pinnata |
Taxus baccata |
Taxus cuspidata |
PubChem | 163097550 |
LOTUS | LTS0260461 |
wikiData | Q104972252 |