2-Tetradecanol
| Internal ID | 9ed7fd4d-81c1-4043-bdea-191f2d4e7925 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty alcohols > Long-chain fatty alcohols |
| IUPAC Name | tetradecan-2-ol |
| SMILES (Canonical) | CCCCCCCCCCCCC(C)O |
| SMILES (Isomeric) | CCCCCCCCCCCCC(C)O |
| InChI | InChI=1S/C14H30O/c1-3-4-5-6-7-8-9-10-11-12-13-14(2)15/h14-15H,3-13H2,1-2H3 |
| InChI Key | BRGJIIMZXMWMCC-UHFFFAOYSA-N |
| Popularity | 43 references in papers |
| Molecular Formula | C14H30O |
| Molecular Weight | 214.39 g/mol |
| Exact Mass | 214.229665576 g/mol |
| Topological Polar Surface Area (TPSA) | 20.20 Ų |
| XlogP | 6.10 |
| Tetradecan-2-ol |
| 4706-81-4 |
| sec-Tetradecyl alcohol |
| CHEBI:84284 |
| Tetradecanol-2 |
| NSC87599 |
| 1-methyl-tridecanol |
| EINECS 225-192-5 |
| NSC 87599 |
| 2-Tetradecyl Alcohol |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 97.02% | 97.29% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 95.67% | 92.86% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.52% | 98.95% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 93.08% | 87.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.07% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.09% | 97.25% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 89.86% | 85.94% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 88.85% | 92.08% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 88.24% | 93.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.65% | 99.17% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 86.06% | 91.81% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 85.65% | 100.00% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 84.89% | 93.31% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 83.63% | 89.63% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 82.44% | 97.79% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 80.70% | 90.24% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.50% | 96.47% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 80.06% | 98.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Hypericum perforatum |
| Vitis vinifera |
| PubChem | 20831 |
| LOTUS | LTS0223291 |
| wikiData | Q27157648 |