2-Pyrrolidineacetic acid
| Internal ID | a791dcaa-5c80-4537-a947-a64b52119e4b |
| Taxonomy | Organoheterocyclic compounds > Pyrrolidines |
| IUPAC Name | 2-pyrrolidin-2-ylacetic acid |
| SMILES (Canonical) | C1CC(NC1)CC(=O)O |
| SMILES (Isomeric) | C1CC(NC1)CC(=O)O |
| InChI | InChI=1S/C6H11NO2/c8-6(9)4-5-2-1-3-7-5/h5,7H,1-4H2,(H,8,9) |
| InChI Key | ADSALMJPJUKESW-UHFFFAOYSA-N |
| Popularity | 203 references in papers |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.078978594 g/mol |
| Topological Polar Surface Area (TPSA) | 49.30 Ų |
| XlogP | -2.40 |
| 2-(Pyrrolidin-2-yl)acetic acid |
| 2-Pyrrolidineacetic acid |
| (+/-)-Homoproline |
| beta-Homoproline |
| 2-pyrrolidin-2-ylacetic acid |
| PYRROLIDIN-2-YL-ACETIC ACID |
| Pyrrolidine-2-acetic acid |
| C7315YL6ZG |
| 2-Pyrrolidinyl acetic acid |
| UNII-C7315YL6ZG |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.99% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.96% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.41% | 98.95% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 84.01% | 93.03% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 83.09% | 95.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.21% | 94.45% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.59% | 93.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.11% | 97.25% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 80.68% | 98.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Arnica montana |
| Melampodium divaricatum |
| PubChem | 123784 |
| LOTUS | LTS0245282 |
| wikiData | Q27275271 |