2-Phenyl-9-(3-phenylprop-2-enoyl)-1,5,9-triazacyclotridecan-4-one
Internal ID | bb4ae8c8-8cc8-4650-ba44-d8a5dffbc79a |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives |
IUPAC Name | 2-phenyl-9-(3-phenylprop-2-enoyl)-1,5,9-triazacyclotridecan-4-one |
SMILES (Canonical) | C1CCN(CCCNC(=O)CC(NC1)C2=CC=CC=C2)C(=O)C=CC3=CC=CC=C3 |
SMILES (Isomeric) | C1CCN(CCCNC(=O)CC(NC1)C2=CC=CC=C2)C(=O)C=CC3=CC=CC=C3 |
InChI | InChI=1S/C25H31N3O2/c29-24-20-23(22-12-5-2-6-13-22)26-16-7-8-18-28(19-9-17-27-24)25(30)15-14-21-10-3-1-4-11-21/h1-6,10-15,23,26H,7-9,16-20H2,(H,27,29) |
InChI Key | OROFOUPCOTVAJQ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H31N3O2 |
Molecular Weight | 405.50 g/mol |
Exact Mass | 405.24162724 g/mol |
Topological Polar Surface Area (TPSA) | 61.40 Ų |
XlogP | 3.00 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 97.20% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.51% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.99% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.69% | 95.56% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 92.42% | 93.99% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.05% | 97.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.06% | 91.11% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.37% | 99.23% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 88.68% | 93.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.71% | 89.00% |
CHEMBL5028 | O14672 | ADAM10 | 86.93% | 97.50% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.88% | 90.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.43% | 85.14% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 83.48% | 83.57% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.97% | 91.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.97% | 95.89% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.45% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Pleurostylia opposita |
PubChem | 78384657 |
LOTUS | LTS0205346 |
wikiData | Q105198071 |