2-O-Methyladenosine
| Internal ID | fa2a791a-9546-4067-a386-3e8e02d49030 |
| Taxonomy | Nucleosides, nucleotides, and analogues > Purine nucleosides |
| IUPAC Name | 5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-ol |
| SMILES (Canonical) | COC1C(C(OC1N2C=NC3=C(N=CN=C32)N)CO)O |
| SMILES (Isomeric) | COC1C(C(OC1N2C=NC3=C(N=CN=C32)N)CO)O |
| InChI | InChI=1S/C11H15N5O4/c1-19-8-7(18)5(2-17)20-11(8)16-4-15-6-9(12)13-3-14-10(6)16/h3-5,7-8,11,17-18H,2H2,1H3,(H2,12,13,14) |
| InChI Key | FPUGCISOLXNPPC-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C11H15N5O4 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.11240398 g/mol |
| Topological Polar Surface Area (TPSA) | 129.00 Ų |
| XlogP | -0.50 |
| 42173-86-4 |
| MFCD00056002 |
| NSC249005 |
| 2-O-methyla-denosine |
| SCHEMBL16359957 |
| DTXSID40312038 |
| NSC-249005 |
| PD093861 |
| SY074163 |
| FT-0649901 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.10% | 96.09% |
| CHEMBL3589 | P55263 | Adenosine kinase | 95.43% | 98.05% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.97% | 94.00% |
| CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 87.72% | 80.33% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.40% | 86.33% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.88% | 91.11% |
| CHEMBL5524 | Q99873 | Protein-arginine N-methyltransferase 1 | 85.70% | 96.67% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.54% | 95.89% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.08% | 97.09% |
| CHEMBL3137261 | O14744 | PRMT5/MEP50 complex | 84.47% | 100.00% |
| CHEMBL5678 | P34947 | G protein-coupled receptor kinase 5 | 83.29% | 88.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.19% | 94.73% |
| CHEMBL4523377 | Q86WV6 | Stimulator of interferon genes protein | 81.95% | 95.48% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.58% | 99.17% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.47% | 96.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.69% | 94.45% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 80.01% | 93.65% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 317398 |
| LOTUS | LTS0118558 |
| wikiData | Q105105422 |