2-O-Galloyl-1,4-galactarolactone
| Internal ID | e2e3ae35-cc13-42da-89cd-0073d943cbe0 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzoic acids and derivatives > Hydroxybenzoic acid derivatives > Gallic acid and derivatives > Galloyl esters |
| IUPAC Name | 2-hydroxy-2-[3-hydroxy-5-oxo-4-(3,4,5-trihydroxybenzoyl)oxyoxolan-2-yl]acetic acid |
| SMILES (Canonical) | C1=C(C=C(C(=C1O)O)O)C(=O)OC2C(C(OC2=O)C(C(=O)O)O)O |
| SMILES (Isomeric) | C1=C(C=C(C(=C1O)O)O)C(=O)OC2C(C(OC2=O)C(C(=O)O)O)O |
| InChI | InChI=1S/C13H12O11/c14-4-1-3(2-5(15)6(4)16)12(21)24-10-7(17)9(23-13(10)22)8(18)11(19)20/h1-2,7-10,14-18H,(H,19,20) |
| InChI Key | GGQABIPBZKETPQ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C13H12O11 |
| Molecular Weight | 344.23 g/mol |
| Exact Mass | 344.03796119 g/mol |
| Topological Polar Surface Area (TPSA) | 191.00 Ų |
| XlogP | -0.60 |
| CHEBI:186130 |
| 2-hydroxy-2-[3-hydroxy-5-oxo-4-(3,4,5-trihydroxybenzoyl)oxyoxolan-2-yl]acetic acid |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.27% | 91.11% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 94.04% | 83.82% |
| CHEMBL3194 | P02766 | Transthyretin | 92.89% | 90.71% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.98% | 99.17% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.94% | 89.00% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 89.13% | 95.64% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.80% | 98.95% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 88.41% | 83.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.92% | 99.15% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.18% | 86.33% |
| CHEMBL245 | P20309 | Muscarinic acetylcholine receptor M3 | 86.87% | 97.53% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.24% | 99.23% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 83.44% | 94.23% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.93% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.69% | 96.09% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 81.27% | 81.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 80.08% | 91.49% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Phyllanthus emblica |
| PubChem | 85198141 |
| LOTUS | LTS0158230 |
| wikiData | Q105008272 |