2-Methylnicotinic acid
| Internal ID | d93bdd9a-48d4-4f83-9b10-9cde9213628d |
| Taxonomy | Organoheterocyclic compounds > Pyridines and derivatives > Pyridinecarboxylic acids and derivatives > Pyridinecarboxylic acids |
| IUPAC Name | 2-methylpyridine-3-carboxylic acid |
| SMILES (Canonical) | CC1=C(C=CC=N1)C(=O)O |
| SMILES (Isomeric) | CC1=C(C=CC=N1)C(=O)O |
| InChI | InChI=1S/C7H7NO2/c1-5-6(7(9)10)3-2-4-8-5/h2-4H,1H3,(H,9,10) |
| InChI Key | HNTZKNJGAFJMHQ-UHFFFAOYSA-N |
| Popularity | 40 references in papers |
| Molecular Formula | C7H7NO2 |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.047678466 g/mol |
| Topological Polar Surface Area (TPSA) | 50.20 Ų |
| XlogP | 0.80 |
| 3222-56-8 |
| 2-Methylpyridine-3-carboxylic acid |
| 2-Methyl-nicotinic acid |
| 2-Methylnicotinicacid |
| 3-pyridinecarboxylic acid, 2-methyl- |
| 2-methyl nicotinic acid |
| MFCD00013449 |
| methylnicotinic acid |
| 2-methylnicotinoic acid |
| SCHEMBL71547 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 91.80% | 81.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.75% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.08% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.86% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 90.05% | 94.73% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 88.64% | 87.67% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 87.85% | 96.47% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 86.83% | 94.42% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.86% | 93.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.79% | 86.33% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.10% | 93.56% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.03% | 95.50% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 82.80% | 97.36% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.47% | 99.23% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.35% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 643373 |
| LOTUS | LTS0121348 |
| wikiData | Q72493345 |