2-Methylidene-3-tetradecylbutanedioic acid
| Internal ID | 5fd697e0-1b1b-4080-acb3-18ce8c6f43fa |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acids and conjugates > Long-chain fatty acids |
| IUPAC Name | 2-methylidene-3-tetradecylbutanedioic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C19H34O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-17(19(22)23)16(2)18(20)21/h17H,2-15H2,1H3,(H,20,21)(H,22,23) |
| InChI Key | CJCOOGIIQHVIQI-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C19H34O4 |
| Molecular Weight | 326.50 g/mol |
| Exact Mass | 326.24570956 g/mol |
| Topological Polar Surface Area (TPSA) | 74.60 Ų |
| XlogP | 7.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 95.52% | 98.95% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 95.41% | 85.94% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 93.99% | 97.29% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.67% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.06% | 96.09% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 90.97% | 93.56% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 90.83% | 92.86% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 88.86% | 83.82% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 85.07% | 93.31% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 84.71% | 92.08% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.95% | 100.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.14% | 90.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 11067379 |
| LOTUS | LTS0210684 |
| wikiData | Q104960869 |