2-Methylhexan-1-ol
| Internal ID | 7570dbd6-f6c5-4a79-b320-788f0240e47d |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty alcohols |
| IUPAC Name | 2-methylhexan-1-ol |
| SMILES (Canonical) | CCCCC(C)CO |
| SMILES (Isomeric) | CCCCC(C)CO |
| InChI | InChI=1S/C7H16O/c1-3-4-5-7(2)6-8/h7-8H,3-6H2,1-2H3 |
| InChI Key | LCFKURIJYIJNRU-UHFFFAOYSA-N |
| Popularity | 31 references in papers |
| Molecular Formula | C7H16O |
| Molecular Weight | 116.20 g/mol |
| Exact Mass | 116.120115130 g/mol |
| Topological Polar Surface Area (TPSA) | 20.20 Ų |
| XlogP | 2.30 |
| 2-methyl-1-hexanol |
| 624-22-6 |
| 1-Hexanol, 2-methyl- |
| 2-methylhexanol |
| 61949-26-6 |
| Z6K9KCS2ZN |
| METHYLHEXANOL |
| 2-methyl-hexan-1-ol |
| EINECS 210-837-5 |
| UNII-Z6K9KCS2ZN |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 94.56% | 98.95% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 94.23% | 97.29% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 92.25% | 87.45% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 89.65% | 93.31% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 88.95% | 92.86% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.74% | 96.09% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 88.26% | 93.56% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.36% | 97.25% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.87% | 99.17% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 84.57% | 91.81% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 83.71% | 97.79% |
| CHEMBL4105838 | Q96GG9 | DCN1-like protein 1 | 81.07% | 95.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Zingiber mioga |
| PubChem | 43858 |
| LOTUS | LTS0079479 |
| wikiData | Q27894765 |