2-Methylbenzofuran-4-carbaldehyde
Internal ID | 27e13306-8945-4db2-876a-54f74573a69e |
Taxonomy | Organoheterocyclic compounds > Benzofurans |
IUPAC Name | 2-methyl-1-benzofuran-4-carbaldehyde |
SMILES (Canonical) | CC1=CC2=C(C=CC=C2O1)C=O |
SMILES (Isomeric) | CC1=CC2=C(C=CC=C2O1)C=O |
InChI | InChI=1S/C10H8O2/c1-7-5-9-8(6-11)3-2-4-10(9)12-7/h2-6H,1H3 |
InChI Key | FKJDUAWKFXHUKH-UHFFFAOYSA-N |
Popularity | 5 references in papers |
Molecular Formula | C10H8O2 |
Molecular Weight | 160.17 g/mol |
Exact Mass | 160.052429494 g/mol |
Topological Polar Surface Area (TPSA) | 30.20 Ų |
XlogP | 2.20 |
2-methylbenzofuran-4-carbaldehyde |
SCHEMBL6681988 |
2-Methylbenzofuran-4-carbaldehyd |
FKJDUAWKFXHUKH-UHFFFAOYSA-N |
2-Methyl-benzofuran-4-carboxaldehyde |
AKOS006372741 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.99% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 94.68% | 94.73% |
CHEMBL2581 | P07339 | Cathepsin D | 90.47% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.89% | 86.33% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 87.58% | 94.80% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 87.09% | 98.11% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.48% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.81% | 89.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.37% | 96.00% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 83.22% | 93.65% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Habropetalum dawei |
PubChem | 13170313 |
LOTUS | LTS0172947 |
wikiData | Q104996641 |