2-(methylamino)-N-phenethylbenzamide
| Internal ID | 0f3ea9f0-394b-434a-8c66-7561d2a09f2f |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzoic acids and derivatives > Benzamides > Anthranilamides |
| IUPAC Name | 2-(methylamino)-N-(2-phenylethyl)benzamide |
| SMILES (Canonical) | CNC1=CC=CC=C1C(=O)NCCC2=CC=CC=C2 |
| SMILES (Isomeric) | CNC1=CC=CC=C1C(=O)NCCC2=CC=CC=C2 |
| InChI | InChI=1S/C16H18N2O/c1-17-15-10-6-5-9-14(15)16(19)18-12-11-13-7-3-2-4-8-13/h2-10,17H,11-12H2,1H3,(H,18,19) |
| InChI Key | QDLVHIXBWKCXDP-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.141913202 g/mol |
| Topological Polar Surface Area (TPSA) | 41.10 Ų |
| XlogP | 3.70 |
| 19050-63-6 |
| 2-(methylamino)-N-(2-phenylethyl)benzamide |
| Glycoamide A |
| 2-METHYLAMINO-N-PHENETHYL-BENZAMIDE |
| [2-(methylamino)phenyl]-N-(2-phenylethyl)carboxamide |
| Maybridge1_003437 |
| Oprea1_702176 |
| SCHEMBL3407189 |
| SCHEMBL29858570 |
| HMS551E05 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.44% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.60% | 96.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.84% | 90.17% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.12% | 94.73% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 88.27% | 89.34% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.93% | 95.50% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.97% | 91.11% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.85% | 98.75% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 83.15% | 87.67% |
| CHEMBL2096618 | P11274 | Bcr/Abl fusion protein | 82.65% | 85.83% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.57% | 90.00% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 81.56% | 93.81% |
| CHEMBL5847 | P52895 | Aldo-keto reductase family 1 member C2 | 81.49% | 92.50% |
| CHEMBL5028 | O14672 | ADAM10 | 81.12% | 97.50% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.47% | 95.56% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.28% | 93.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 2806589 |
| LOTUS | LTS0128314 |
| wikiData | Q82176705 |