2-Methyl-6-propylpiperidine
Internal ID | f281f411-0295-4222-bd1c-cc1872beb697 |
Taxonomy | Alkaloids and derivatives |
IUPAC Name | 2-methyl-6-propylpiperidine |
SMILES (Canonical) | CCCC1CCCC(N1)C |
SMILES (Isomeric) | CCCC1CCCC(N1)C |
InChI | InChI=1S/C9H19N/c1-3-5-9-7-4-6-8(2)10-9/h8-10H,3-7H2,1-2H3 |
InChI Key | BHBZNQCZKUGKCJ-UHFFFAOYSA-N |
Popularity | 9 references in papers |
Molecular Formula | C9H19N |
Molecular Weight | 141.25 g/mol |
Exact Mass | 141.151749610 g/mol |
Topological Polar Surface Area (TPSA) | 12.00 Ų |
XlogP | 2.40 |
68170-79-6 |
Dihydropinidine |
2-Methyl-6-propyl-piperidine |
SCHEMBL2698232 |
DTXSID60340696 |
BHBZNQCZKUGKCJ-UHFFFAOYSA-N |
AKOS006348473 |
EN300-693007 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.33% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.33% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.18% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 93.15% | 98.95% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 89.28% | 95.93% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 86.55% | 99.18% |
CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 85.94% | 97.23% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 84.23% | 97.64% |
CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 82.01% | 90.71% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.38% | 95.50% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.09% | 94.45% |
CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 80.44% | 97.64% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 80.30% | 97.79% |
CHEMBL2916 | O14746 | Telomerase reverse transcriptase | 80.06% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Picea abies |
Picea sitchensis |
PubChem | 566623 |
LOTUS | LTS0273100 |
wikiData | Q82110474 |