alpha-Methyldethiobiotin
| Internal ID | 71e26b79-1180-4299-a4b6-545524523767 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acids and conjugates > Medium-chain fatty acids |
| IUPAC Name | 2-methyl-6-(5-methyl-2-oxoimidazolidin-4-yl)hexanoic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C11H20N2O3/c1-7(10(14)15)5-3-4-6-9-8(2)12-11(16)13-9/h7-9H,3-6H2,1-2H3,(H,14,15)(H2,12,13,16) |
| InChI Key | DSLSWBIYQALLJM-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14739250 g/mol |
| Topological Polar Surface Area (TPSA) | 78.40 Ų |
| XlogP | 1.30 |
| 2-methyl-6-(5-methyl-2-oxoimidazolidin-4-yl)hexanoic acid |
| 31602-99-0 |
| .alpha.-Dethiobiotin |
| BIOTIN, ALPHA |
| .alpha.-Methyldethiobiotin |
| Biotin, .alpha.-methyldethio- |
| DTXSID40958051 |
| DTXSID70276598 |
| NSC116327 |
| NSC-116327 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 96.52% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.61% | 96.09% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.90% | 90.71% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.34% | 93.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.94% | 94.45% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.39% | 97.25% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 84.02% | 85.31% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.27% | 99.17% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.19% | 96.47% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 81.77% | 100.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.47% | 95.56% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.30% | 93.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.28% | 91.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 169822 |
| LOTUS | LTS0217375 |
| wikiData | Q77574013 |