2-Methyl-6-[[3,4,5-trihydroxy-6-(4-hydroxy-3-methoxyphenoxy)oxan-2-yl]methoxy]oxane-3,4,5-triol
Internal ID | d2faca85-84fc-47b3-a205-0c032d011bba |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
IUPAC Name | 2-methyl-6-[[3,4,5-trihydroxy-6-(4-hydroxy-3-methoxyphenoxy)oxan-2-yl]methoxy]oxane-3,4,5-triol |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=CC(=C(C=C3)O)OC)O)O)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=CC(=C(C=C3)O)OC)O)O)O)O)O)O |
InChI | InChI=1S/C19H28O12/c1-7-12(21)14(23)16(25)18(29-7)28-6-11-13(22)15(24)17(26)19(31-11)30-8-3-4-9(20)10(5-8)27-2/h3-5,7,11-26H,6H2,1-2H3 |
InChI Key | BFAJLSKYUOPYBU-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H28O12 |
Molecular Weight | 448.40 g/mol |
Exact Mass | 448.15807632 g/mol |
Topological Polar Surface Area (TPSA) | 188.00 Ų |
XlogP | -2.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.47% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.81% | 96.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.37% | 91.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.24% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.45% | 94.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 92.18% | 97.36% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.77% | 99.17% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.71% | 99.15% |
CHEMBL4208 | P20618 | Proteasome component C5 | 90.29% | 90.00% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 89.12% | 89.62% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.55% | 95.89% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.45% | 96.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.34% | 94.73% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.32% | 92.94% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 86.21% | 95.93% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.23% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.49% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.73% | 97.09% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.57% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 80.28% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Sargentodoxa cuneata |
PubChem | 72999791 |
LOTUS | LTS0080281 |
wikiData | Q104933842 |