2'-Methyl-3,6-dimethylidenespiro[3a,4,7,7a-tetrahydro-1-benzofuran-5,1'-cyclopentane]-2-one
| Internal ID | abddbeb2-ee0f-49fb-81a0-4cac4ca66c6c |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
| IUPAC Name | 2'-methyl-3,6-dimethylidenespiro[3a,4,7,7a-tetrahydro-1-benzofuran-5,1'-cyclopentane]-2-one |
| SMILES (Canonical) | CC1CCCC12CC3C(CC2=C)OC(=O)C3=C |
| SMILES (Isomeric) | CC1CCCC12CC3C(CC2=C)OC(=O)C3=C |
| InChI | InChI=1S/C15H20O2/c1-9-5-4-6-15(9)8-12-11(3)14(16)17-13(12)7-10(15)2/h9,12-13H,2-8H2,1H3 |
| InChI Key | YWGQGEZTRMMMBF-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.146329876 g/mol |
| Topological Polar Surface Area (TPSA) | 26.30 Ų |
| XlogP | 3.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.10% | 97.25% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 93.15% | 97.05% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.24% | 97.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.29% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.59% | 91.11% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.54% | 99.23% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 84.26% | 96.61% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.94% | 94.45% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 83.72% | 96.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.24% | 100.00% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.03% | 93.03% |
| CHEMBL3920 | Q04759 | Protein kinase C theta | 81.71% | 97.69% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 81.61% | 93.04% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.31% | 85.14% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 81.11% | 99.18% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.74% | 95.89% |
| CHEMBL3012 | Q13946 | Phosphodiesterase 7A | 80.59% | 99.29% |
| CHEMBL2581 | P07339 | Cathepsin D | 80.43% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ratibida columnifera |
| PubChem | 162963184 |
| LOTUS | LTS0074118 |
| wikiData | Q105366524 |