2-Methoxycanthin-6-one
Internal ID | d2eceb25-9e0b-4fdb-b188-c85da4a807bf |
Taxonomy | Alkaloids and derivatives > Indolonaphthyridine alkaloids |
IUPAC Name | 7-methoxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-2-one |
SMILES (Canonical) | COC1=NC2=C3C(=C1)C4=CC=CC=C4N3C(=O)C=C2 |
SMILES (Isomeric) | COC1=NC2=C3C(=C1)C4=CC=CC=C4N3C(=O)C=C2 |
InChI | InChI=1S/C15H10N2O2/c1-19-13-8-10-9-4-2-3-5-12(9)17-14(18)7-6-11(16-13)15(10)17/h2-8H,1H3 |
InChI Key | CDWAXMGQLZGHDU-UHFFFAOYSA-N |
Popularity | 2 references in papers |
Molecular Formula | C15H10N2O2 |
Molecular Weight | 250.25 g/mol |
Exact Mass | 250.074227566 g/mol |
Topological Polar Surface Area (TPSA) | 44.10 Ų |
XlogP | 2.70 |
116353-93-6 |
7-methoxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-2-one |
CHEBI:174291 |
DTXSID701218613 |
2-Methoxy-6H-indolo[3,2,1-de][1,5]naphthyridin-6-one |
2-Methoxy-6H-indolo[3,2,1-de][1,5]naphthyridin-6-one, 9CI |
7-methoxy-1,6-diazatetracyclo[7.6.1.0^{5,16}.0^{10,15}]hexadeca-3,5(16),6,8,10,12,14-heptaen-2-one |
![2D Structure of 2-Methoxycanthin-6-one 2D Structure of 2-Methoxycanthin-6-one](https://plantaedb.com/storage/docs/compounds/2023/11/2-methoxycanthin-6-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.34% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.12% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 95.22% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.07% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.33% | 94.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.14% | 96.00% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 87.76% | 92.97% |
CHEMBL2535 | P11166 | Glucose transporter | 87.00% | 98.75% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.59% | 99.23% |
CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 85.90% | 92.67% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.90% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.50% | 91.11% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 81.59% | 93.65% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 80.72% | 96.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Quassia amara |
PubChem | 10106139 |
LOTUS | LTS0094552 |
wikiData | Q104955253 |